Difference between revisions of "PWY0-1507"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-97 CPD1F-97] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1507 PWY0-1507] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-97 CPD1F-97] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1507 PWY0-1507] ==
−
* smiles:
+
* taxonomic range:
−
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
** InChIKey=TZGXVFYTKTWKCU-CXXOJBQZSA-L
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
−
** gibberellin A15 (open lactone form)
+
** biotin biosynthesis from 8-amino-7-oxononanoate I
−
* molecular weight:
+
−
** 346.422   
+
 
* Synonym(s):
 
* Synonym(s):
−
** gibberellin A15
+
** biotin biosynthesis from 7-keto-8-aminopelargonate
−
** GA15
+
−
** GA15 (open lactone form)
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN1F-163]]
+
'''3''' reactions found over '''3''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[2.8.1.6-RXN]]
−
* [[RXN1F-162]]
+
** 1 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-24_000980]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[DAPASYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_005750]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[DETHIOBIOTIN-SYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_005750]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR0104170017
+
* ECOCYC:
−
* PUBCHEM:
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-1507 PWY0-1507]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245948 25245948]
+
{{#set: taxonomic range=TAX-4751}}
−
* CHEBI:
+
{{#set: taxonomic range=TAX-33090}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29590 29590]
+
{{#set: taxonomic range=TAX-2}}
−
* LIGAND-CPD:
+
{{#set: common name=biotin biosynthesis from 8-amino-7-oxononanoate I}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11860 C11860]
+
{{#set: common name=biotin biosynthesis from 7-keto-8-aminopelargonate}}
−
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
+
{{#set: reaction found=3}}
−
{{#set: inchi key=InChIKey=TZGXVFYTKTWKCU-CXXOJBQZSA-L}}
+
{{#set: total reaction=3}}
−
{{#set: common name=gibberellin A15 (open lactone form)}}
+
{{#set: completion rate=100.0}}
−
{{#set: molecular weight=346.422    }}
+
−
{{#set: common name=gibberellin A15|GA15|GA15 (open lactone form)}}
+
−
{{#set: consumed by=RXN1F-163}}
+
−
{{#set: produced by=RXN1F-162}}
+

Latest revision as of 19:02, 21 March 2018

Pathway PWY0-1507

  • taxonomic range:
  • common name:
    • biotin biosynthesis from 8-amino-7-oxononanoate I
  • Synonym(s):
    • biotin biosynthesis from 7-keto-8-aminopelargonate

Reaction(s) found

3 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY0-1507&oldid=24085"