Difference between revisions of "Ec-00 008830"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12177 CPD-12177] == * smiles: ** CC([CH]=O)C(=O)[O-] * inchi key: ** InChIKey=VOKUMXABRRXHA...")
(Created page with "Category:Gene == Gene Ec-00_008830 == * left end position: ** 14608008 * transcription direction: ** POSITIVE * right end position: ** 14613250 * centisome position: ** 77...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12177 CPD-12177] ==
+
== Gene Ec-00_008830 ==
−
* smiles:
+
* left end position:
−
** CC([CH]=O)C(=O)[O-]
+
** 14608008
−
* inchi key:
+
* transcription direction:
−
** InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (R)-methylmalonate-semialdehyde
+
** 14613250
−
* molecular weight:
+
* centisome position:
−
** 101.082    
+
** 77.10163    
 
* Synonym(s):
 
* Synonym(s):
−
** (R)-2-methyl-3-oxopropanoate
+
** Esi_0646_0004
−
** (R)-ch3-malonate-semialdehyde
+
** Esi0646_0004
 +
** CYS
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ACSERLY-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-14056]]
+
*** Assignment: ec-number
 +
* Reaction: [[RXN-12726]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN0-2381]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN0-2382]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[SULFOCYS-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[TRYPSYN-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[CYSTSYN-PWY]]
 +
* [[PWY-6949]]
 +
* [[PWY-6936]]
 +
* [[TRPSYN-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=14608008}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173310 46173310]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CC([CH]=O)C(=O)[O-]}}
+
{{#set: right end position=14613250}}
−
{{#set: inchi key=InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M}}
+
{{#set: centisome position=77.10163   }}
−
{{#set: common name=(R)-methylmalonate-semialdehyde}}
+
{{#set: common name=Esi_0646_0004|Esi0646_0004|CYS}}
−
{{#set: molecular weight=101.082   }}
+
{{#set: reaction associated=ACSERLY-RXN|RXN-12726|RXN0-2381|RXN0-2382|SULFOCYS-RXN|TRYPSYN-RXN}}
−
{{#set: common name=(R)-2-methyl-3-oxopropanoate|(R)-ch3-malonate-semialdehyde}}
+
{{#set: pathway associated=CYSTSYN-PWY|PWY-6949|PWY-6936|TRPSYN-PWY}}
−
{{#set: reversible reaction associated=RXN-14056}}
+

Latest revision as of 19:02, 21 March 2018

Gene Ec-00_008830

  • left end position:
    • 14608008
  • transcription direction:
    • POSITIVE
  • right end position:
    • 14613250
  • centisome position:
    • 77.10163
  • Synonym(s):
    • Esi_0646_0004
    • Esi0646_0004
    • CYS

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-00_008830&oldid=24087"