Difference between revisions of "CPD-14053"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16042 RXN-16042] == * direction: ** LEFT-TO-RIGHT * common name: ** Lyso-phosphatidylcholine ac...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14053 CPD-14053] == * smiles: ** CC(O)C(O)[CH]1(CNC2(N=C(N)NC(C(N1)=2)=O)) * common name: *...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14053 CPD-14053] == |
− | * | + | * smiles: |
− | ** | + | ** CC(O)C(O)[CH]1(CNC2(N=C(N)NC(C(N1)=2)=O)) |
* common name: | * common name: | ||
− | ** | + | ** L-erythro-5,6,7,8-tetrahydrobiopterin |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=FNKQXYHWGSIFBK-RPDRRWSUSA-N |
+ | * molecular weight: | ||
+ | ** 241.249 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** (6R)-5,6,7,8-tetrahydrobiopterin | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN66-569]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-8853]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44257 44257] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59560 59560] |
− | {{#set: | + | * METABOLIGHTS : MTBLC59560 |
− | {{#set: | + | * HMDB : HMDB00787 |
− | + | {{#set: smiles=CC(O)C(O)[CH]1(CNC2(N=C(N)NC(C(N1)=2)=O))}} | |
− | {{#set: | + | {{#set: common name=L-erythro-5,6,7,8-tetrahydrobiopterin}} |
+ | {{#set: inchi key=InChIKey=FNKQXYHWGSIFBK-RPDRRWSUSA-N}} | ||
+ | {{#set: molecular weight=241.249 }} | ||
+ | {{#set: common name=(6R)-5,6,7,8-tetrahydrobiopterin}} | ||
+ | {{#set: consumed by=RXN66-569}} | ||
+ | {{#set: produced by=RXN-8853}} |
Latest revision as of 19:02, 21 March 2018
Contents
Metabolite CPD-14053
- smiles:
- CC(O)C(O)[CH]1(CNC2(N=C(N)NC(C(N1)=2)=O))
- common name:
- L-erythro-5,6,7,8-tetrahydrobiopterin
- inchi key:
- InChIKey=FNKQXYHWGSIFBK-RPDRRWSUSA-N
- molecular weight:
- 241.249
- Synonym(s):
- (6R)-5,6,7,8-tetrahydrobiopterin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(O)C(O)[CH]1(CNC2(N=C(N)NC(C(N1)=2)=O))" cannot be used as a page name in this wiki.