Difference between revisions of "Ec-15 001900"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-COUMAROYL-COA P-COUMAROYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=CC(O)=...")
 
(Created page with "Category:Gene == Gene Ec-15_001900 == * left end position: ** 2161716 * transcription direction: ** POSITIVE * right end position: ** 2166550 * centisome position: ** 40.0...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-COUMAROYL-COA P-COUMAROYL-COA] ==
+
== Gene Ec-15_001900 ==
−
* smiles:
+
* left end position:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** 2161716
−
* inchi key:
+
* transcription direction:
−
** InChIKey=DMZOKBALNZWDKI-MATMFAIHSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 4-coumaroyl-CoA
+
** 2166550
−
* molecular weight:
+
* centisome position:
−
** 909.648    
+
** 40.044735    
 
* Synonym(s):
 
* Synonym(s):
−
** p-coumaroyl-CoA
+
** Esi_0056_0014
−
** 4-hydroxycinnamoyl-CoA
+
** Esi0056_0014
−
** 4-coumaryl-CoA
+
−
** p-coumaryl-CoA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-11244]]
+
* Reaction: [[CDPDIGLYSYN-RXN]]
−
* [[RXN-1101]]
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
+
*** Assignment: ec-number
−
* [[RXN-3142]]
+
* Reaction: [[RXN0-5515]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[4-COUMARATE--COA-LIGASE-RXN]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-5667]]
 +
* [[PWY0-1319]]
 +
* [[PWY-5981]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2161716}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266584 45266584]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=2166550}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15499 15499]
+
{{#set: centisome position=40.044735   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0056_0014|Esi0056_0014}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00223 C00223]
+
{{#set: reaction associated=CDPDIGLYSYN-RXN|RXN0-5515}}
−
* HMDB : HMDB60153
+
{{#set: pathway associated=PWY-5667|PWY0-1319|PWY-5981}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=DMZOKBALNZWDKI-MATMFAIHSA-J}}
+
−
{{#set: common name=4-coumaroyl-CoA}}
+
−
{{#set: molecular weight=909.648   }}
+
−
{{#set: common name=p-coumaroyl-CoA|4-hydroxycinnamoyl-CoA|4-coumaryl-CoA|p-coumaryl-CoA}}
+
−
{{#set: consumed by=RXN-11244|RXN-1101|NARINGENIN-CHALCONE-SYNTHASE-RXN|RXN-3142}}
+
−
{{#set: produced by=4-COUMARATE--COA-LIGASE-RXN}}
+

Latest revision as of 19:02, 21 March 2018

Gene Ec-15_001900

  • left end position:
    • 2161716
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2166550
  • centisome position:
    • 40.044735
  • Synonym(s):
    • Esi_0056_0014
    • Esi0056_0014

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-15_001900&oldid=24111"