Difference between revisions of "PWY-5826"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-GLY CYS-GLY] == * smiles: ** C(C([O-])=O)NC(C(CS)[N+])=O * inchi key: ** InChIKey=ZUKPVRWZD...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5826 PWY-5826] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-31...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5826 PWY-5826] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** hypoglycin biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''4''' reactions found over '''14''' reactions in the full pathway |
− | + | * [[RXN-15121]] | |
− | * [[RXN- | + | ** 0 associated gene: |
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-15122]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Ec-06_007490]] | ||
+ | *** [[Ec-03_001910]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-15123]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
* [[RXN-9157]] | * [[RXN-9157]] | ||
− | == Reaction(s) | + | ** 1 associated gene(s): |
+ | *** [[Ec-21_006220]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9167 RXN-9167] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9168 RXN-9168] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9169 RXN-9169] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9170 RXN-9170] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9171 RXN-9171] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9172 RXN-9172] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9173 RXN-9173] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9174 RXN-9174] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9175 RXN-9175] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9189 RXN-9189] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-3193}} | |
− | + | {{#set: common name=hypoglycin biosynthesis}} | |
− | + | {{#set: reaction found=4}} | |
− | + | {{#set: total reaction=14}} | |
− | + | {{#set: completion rate=29.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:03, 21 March 2018
Pathway PWY-5826
- taxonomic range:
- common name:
- hypoglycin biosynthesis
- Synonym(s):
Reaction(s) found
4 reactions found over 14 reactions in the full pathway
- RXN-15121
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-15122
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-15123
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-9157
- 1 associated gene(s):
- 1 reconstruction source(s) associated: