Difference between revisions of "RXN66-482"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCEROL-P INDOLE-3-GLYCEROL-P] == * smiles: ** C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-482 RXN66-482] == * direction: ** LEFT-TO-RIGHT * common name: ** Trans-2-enoyl-CoA reductase...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCEROL-P INDOLE-3-GLYCEROL-P] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-482 RXN66-482] ==
−
* smiles:
+
* direction:
−
** C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=NQEQTYPJSIEPHW-MNOVXSKESA-L
+
 
* common name:
 
* common name:
−
** (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate
+
** Trans-2-enoyl-CoA reductase, mitochondrial precursor
−
* molecular weight:
+
* ec number:
−
** 285.193   
+
** [http://enzyme.expasy.org/EC/1.3.1.38 EC-1.3.1.38]
 
* Synonym(s):
 
* Synonym(s):
−
** C1-(3-Indolyl)-glycerol 3-phosphate
 
−
** indole-3-glycerol-P
 
−
** 1-(indol-3-yl)glycerol-3-P
 
−
** 1-(indol-3-yl)glycerol-3-phosphate
 
−
** indoleglycerol phosphate
 
−
** indole-3-glycerol-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[TRYPSYN-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-14928]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-206]][c] '''+''' 1 [[NADP]][c]
−
* [[IGPSYN-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 phytenoyl-CoA[c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 phytanoyl-CoA[c] '''+''' 1 NADP+[c]
−
* [[RXN0-2381]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-07_005200]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY66-389]], phytol degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-389 PWY66-389]
 +
** '''3''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878464 46878464]
+
{{#set: common name=Trans-2-enoyl-CoA reductase, mitochondrial precursor}}
−
* CHEBI:
+
{{#set: ec number=EC-1.3.1.38}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58866 58866]
+
{{#set: gene associated=Ec-07_005200}}
−
* BIGG : 41982
+
{{#set: in pathway=PWY66-389}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03506 C03506]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: smiles=C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: inchi key=InChIKey=NQEQTYPJSIEPHW-MNOVXSKESA-L}}
+
−
{{#set: common name=(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate}}
+
−
{{#set: molecular weight=285.193    }}
+
−
{{#set: common name=C1-(3-Indolyl)-glycerol 3-phosphate|indole-3-glycerol-P|1-(indol-3-yl)glycerol-3-P|1-(indol-3-yl)glycerol-3-phosphate|indoleglycerol phosphate|indole-3-glycerol-phosphate}}
+
−
{{#set: consumed by=TRYPSYN-RXN}}
+
−
{{#set: produced by=IGPSYN-RXN}}
+
−
{{#set: reversible reaction associated=RXN0-2381}}
+

Latest revision as of 19:03, 21 March 2018

Reaction RXN66-482

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Trans-2-enoyl-CoA reductase, mitochondrial precursor
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 phytenoyl-CoA[c] + 1 NADPH[c] + 1 H+[c] => 1 phytanoyl-CoA[c] + 1 NADP+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-389, phytol degradation: PWY66-389
    • 3 reactions found over 4 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN66-482&oldid=24147"