Difference between revisions of "Ec-07 005240"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ALPHA-AMINO-EPSILON-KETO-PIMELATE L-ALPHA-AMINO-EPSILON-KETO-PIMELATE] == * smiles: ** C([O-]...")
(Created page with "Category:Gene == Gene Ec-07_005240 == * left end position: ** 5097069 * transcription direction: ** NEGATIVE * right end position: ** 5108542 * centisome position: ** 66.0...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ALPHA-AMINO-EPSILON-KETO-PIMELATE L-ALPHA-AMINO-EPSILON-KETO-PIMELATE] ==
+
== Gene Ec-07_005240 ==
−
* smiles:
+
* left end position:
−
** C([O-])(=O)C(CCCC(C([O-])=O)=O)[N+]
+
** 5097069
−
* inchi key:
+
* transcription direction:
−
** InChIKey=UKCSFKLWNHUBDY-BYPYZUCNSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** L-α-amino-ε-keto-pimelate
+
** 5108542
−
* molecular weight:
+
* centisome position:
−
** 188.16    
+
** 66.00343    
 
* Synonym(s):
 
* Synonym(s):
−
** L-2-Amino-6-oxopimelate
+
** Esi_0176_0045
−
** L-2-Amino-6-oxoheptanedioate
+
** Esi0176_0045
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.2.1.21-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-4821]]
+
*** Assignment: ec-number
 +
* Reaction: [[RXN-10769]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-10773]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13600]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13602]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13603]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14179]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-5341]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-8036]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-9674]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-3121]]
 +
* [[PWY-6002]]
 +
* [[PWY-6788]]
 +
* [[PWY-5176]]
 +
* [[PWY-7092]]
 +
* [[PWY-7091]]
 +
* [[PWY-7089]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=5097069}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202391 25202391]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=5108542}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58556 58556]
+
{{#set: centisome position=66.00343   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0176_0045|Esi0176_0045}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03871 C03871]
+
{{#set: reaction associated=3.2.1.21-RXN|RXN-10769|RXN-10773|RXN-13600|RXN-13602|RXN-13603|RXN-14179|RXN-5341|RXN-8036|RXN-9674}}
−
{{#set: smiles=C([O-])(=O)C(CCCC(C([O-])=O)=O)[N+]}}
+
{{#set: pathway associated=PWY-3121|PWY-6002|PWY-6788|PWY-5176|PWY-7092|PWY-7091|PWY-7089}}
−
{{#set: inchi key=InChIKey=UKCSFKLWNHUBDY-BYPYZUCNSA-M}}
+
−
{{#set: common name=L-α-amino-ε-keto-pimelate}}
+
−
{{#set: molecular weight=188.16   }}
+
−
{{#set: common name=L-2-Amino-6-oxopimelate|L-2-Amino-6-oxoheptanedioate}}
+
−
{{#set: reversible reaction associated=RXN-4821}}
+

Latest revision as of 19:03, 21 March 2018

Gene Ec-07_005240

  • left end position:
    • 5097069
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 5108542
  • centisome position:
    • 66.00343
  • Synonym(s):
    • Esi_0176_0045
    • Esi0176_0045

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-07_005240&oldid=24164"