Difference between revisions of "PWY-7102"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGDP DGDP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=2...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7102 PWY-7102] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGDP DGDP] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7102 PWY-7102] ==
* smiles:
+
* taxonomic range:
** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
** InChIKey=CIKGWCTVFSRMJU-KVQBGUIXSA-K
+
 
* common name:
 
* common name:
** dGDP
+
** bisabolene biosynthesis (engineered)
* molecular weight:
+
** 424.18   
+
 
* Synonym(s):
 
* Synonym(s):
** 2'-deoxyguanosine-5'-diphosphate
 
** deoxyguanosine-diphosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[DGDPKIN-RXN]]
+
'''3''' reactions found over '''6''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[FPPSYN-RXN]]
* [[RXN0-748]]
+
** 3 associated gene(s):
* [[RXN-14217]]
+
*** [[Ec-10_003020]]
* [[GDPREDUCT-RXN]]
+
*** [[Ec-07_006170]]
== Reaction(s) of unknown directionality ==
+
*** [[Ec-16_004330]]
* [[RXN-14207]]
+
** 2 reconstruction source(s) associated:
* [[RXN-14218]]
+
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[GPPSYN-RXN]]
 +
** 12 associated gene(s):
 +
*** [[Ec-21_000990]]
 +
*** [[Ec-14_006550]]
 +
*** [[Ec-08_002270]]
 +
*** [[Ec-00_007350]]
 +
*** [[Ec-25_002110]]
 +
*** [[Ec-10_003020]]
 +
*** [[Ec-18_000990]]
 +
*** [[Ec-26_003280]]
 +
*** [[Ec-17_001240]]
 +
*** [[Ec-16_004330]]
 +
*** [[Ec-07_006170]]
 +
*** [[Ec-24_003910]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[IPPISOM-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-11_001030]]
 +
*** [[Ec-18_002690]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8429 RXN-8429]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8549 RXN-8549]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8550 RXN-8550]
 
== External links  ==
 
== External links  ==
* CAS : 102783-74-4
+
{{#set: taxonomic range=TAX-2759}}
* BIGG : 34741
+
{{#set: taxonomic range=TAX-1224}}
* PUBCHEM:
+
{{#set: common name=bisabolene biosynthesis (engineered)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245673 25245673]
+
{{#set: reaction found=3}}
* HMDB : HMDB00960
+
{{#set: total reaction=6}}
* LIGAND-CPD:
+
{{#set: completion rate=50.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C00361 C00361]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58595 58595]
+
* METABOLIGHTS : MTBLC58595
+
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
+
{{#set: inchi key=InChIKey=CIKGWCTVFSRMJU-KVQBGUIXSA-K}}
+
{{#set: common name=dGDP}}
+
{{#set: molecular weight=424.18    }}
+
{{#set: common name=2'-deoxyguanosine-5'-diphosphate|deoxyguanosine-diphosphate}}
+
{{#set: consumed by=DGDPKIN-RXN}}
+
{{#set: produced by=RXN0-748|RXN-14217|GDPREDUCT-RXN}}
+
{{#set: consumed or produced by=RXN-14207|RXN-14218}}
+

Latest revision as of 20:03, 21 March 2018

Pathway PWY-7102

  • taxonomic range:
  • common name:
    • bisabolene biosynthesis (engineered)
  • Synonym(s):

Reaction(s) found

3 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links