Difference between revisions of "RXN-3661"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4125 CPD-4125] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-3661 RXN-3661] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4125 CPD-4125] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-3661 RXN-3661] ==
−
* smiles:
+
* direction:
−
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N
+
** [http://enzyme.expasy.org/EC/1.14.12.23 EC-1.14.12.23]
−
* common name:
+
−
** avenasterol
+
−
* molecular weight:
+
−
** 412.698   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-4209]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[NADH]][c] '''+''' 1 [[BENZENE-NO2]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[CATECHOL]][c] '''+''' 1 [[NITRITE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NADH[c] '''+''' 1 nitrobenzene[c] '''+''' 1 oxygen[c] '''=>''' 1 NAD+[c] '''+''' 1 catechol[c] '''+''' 1 nitrite[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-07_007260]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-24_002140]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-10_006240]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-24_002150]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-00_005820]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-00_005850]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-5640]], nitrobenzene degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5640 PWY-5640]
 +
** '''1''' reactions found over '''1''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245230 25245230]
+
** [http://www.genome.jp/dbget-bin/www_bget?R07706 R07706]
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15782 C15782]
+
{{#set: ec number=EC-1.14.12.23}}
−
* HMDB : HMDB06851
+
{{#set: gene associated=Ec-07_007260|Ec-24_002140|Ec-10_006240|Ec-24_002150|Ec-00_005820|Ec-00_005850}}
−
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: in pathway=PWY-5640}}
−
{{#set: inchi key=InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: common name=avenasterol}}
+
{{#set: reconstruction source=orthology-aragem}}
−
{{#set: molecular weight=412.698    }}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: consumed by=RXN-4209}}
+

Latest revision as of 20:03, 21 March 2018

Reaction RXN-3661

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5640, nitrobenzene degradation II: PWY-5640
    • 1 reactions found over 1 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-3661&oldid=24244"