Difference between revisions of "GLC-6-P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-02_001380 == * left end position: ** 1699580 * transcription direction: ** POSITIVE * right end position: ** 1709041 * centisome position: ** 26.0...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O * inchi key: ** InChIK...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-02_001380 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] ==
* left end position:
+
* smiles:
** 1699580
+
** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L
* right end position:
+
* common name:
** 1709041
+
** β-D-glucose 6-phosphate
* centisome position:
+
* molecular weight:
** 26.036066    
+
** 258.121    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0055_0009
+
** β-D-glucose-6-P
** Esi0055_0009
+
** CDPK;2
+
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[PROTEIN-KINASE-RXN]]
+
* [[RXN66-579]]
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
***ec-number
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=1699580}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21604865 21604865]
{{#set: right end position=1709041}}
+
* HMDB : HMDB03498
{{#set: centisome position=26.036066   }}
+
* LIGAND-CPD:
{{#set: common name=Esi_0055_0009|Esi0055_0009|CDPK;2}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01172 C01172]
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
+
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.10239176.html 10239176]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58247 58247]
 +
* BIGG : 36977
 +
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O}}
 +
{{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L}}
 +
{{#set: common name=β-D-glucose 6-phosphate}}
 +
{{#set: molecular weight=258.121   }}
 +
{{#set: common name=β-D-glucose-6-P}}
 +
{{#set: consumed by=RXN66-579}}

Latest revision as of 20:03, 21 March 2018

Metabolite GLC-6-P

  • smiles:
    • C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O
  • inchi key:
    • InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L
  • common name:
    • β-D-glucose 6-phosphate
  • molecular weight:
    • 258.121
  • Synonym(s):
    • β-D-glucose-6-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O" cannot be used as a page name in this wiki.