Difference between revisions of "PWY-7053"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O * inchi key: ** InChIK...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7053 PWY-7053] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7053 PWY-7053] ==
−
* smiles:
+
* taxonomic range:
−
** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3041 TAX-3041]
−
** InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3208 TAX-3208]
 
* common name:
 
* common name:
−
** β-D-glucose 6-phosphate
+
** docosahexaenoate biosynthesis I (lower eukaryotes)
−
* molecular weight:
+
−
** 258.121   
+
 
* Synonym(s):
 
* Synonym(s):
−
** β-D-glucose-6-P
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN66-579]]
+
'''5''' reactions found over '''7''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-13442]]
−
== Reaction(s) of unknown directionality ==
+
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-13443]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-13444]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-13445]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-17688]]
 +
** 1 associated gene(s):
 +
*** [[Ec-16_002160]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12797 RXN-12797]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16102 RXN-16102]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2759}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21604865 21604865]
+
{{#set: taxonomic range=TAX-3041}}
−
* HMDB : HMDB03498
+
{{#set: taxonomic range=TAX-3208}}
−
* LIGAND-CPD:
+
{{#set: common name=docosahexaenoate biosynthesis I (lower eukaryotes)}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01172 C01172]
+
{{#set: reaction found=5}}
−
* CHEMSPIDER:
+
{{#set: total reaction=7}}
−
** [http://www.chemspider.com/Chemical-Structure.10239176.html 10239176]
+
{{#set: completion rate=71.0}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58247 58247]
+
−
* BIGG : 36977
+
−
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O}}
+
−
{{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L}}
+
−
{{#set: common name=β-D-glucose 6-phosphate}}
+
−
{{#set: molecular weight=258.121    }}
+
−
{{#set: common name=β-D-glucose-6-P}}
+
−
{{#set: consumed by=RXN66-579}}
+

Latest revision as of 19:03, 21 March 2018

Pathway PWY-7053

  • taxonomic range:
  • common name:
    • docosahexaenoate biosynthesis I (lower eukaryotes)
  • Synonym(s):

Reaction(s) found

5 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-7053&oldid=24246"