Difference between revisions of "CPD-7109"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5970 PWY-5970] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7109 CPD-7109] == * smiles: ** CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C * inchi key: **...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5970 PWY-5970] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7109 CPD-7109] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C
 +
* inchi key:
 +
** InChIKey=LWLGKGHHVBVDKB-UHFFFAOYSA-M
 
* common name:
 
* common name:
−
** fatty acids biosynthesis (yeast)
+
** 4-prenylphlorisovalerophenone
 +
* molecular weight:
 +
** 277.339   
 
* Synonym(s):
 
* Synonym(s):
−
** type I fatty acids biosynthesis
+
** PPIVP
 +
** compound-X
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''1''' reactions found over '''1''' reactions in the full pathway
+
* [[RXN-7810]]
−
* [[FATTY-ACYL-COA-SYNTHASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** 0 associated gene:
+
* [[RXN-7811]]
−
** 1 reconstruction source(s) associated:
+
== Reaction(s) of unknown directionality ==
−
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
+
−
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-4751}}
+
* PUBCHEM:
−
{{#set: common name=fatty acids biosynthesis (yeast)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200610 25200610]
−
{{#set: common name=type I fatty acids biosynthesis}}
+
{{#set: smiles=CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C}}
−
{{#set: reaction found=1}}
+
{{#set: inchi key=InChIKey=LWLGKGHHVBVDKB-UHFFFAOYSA-M}}
−
{{#set: total reaction=1}}
+
{{#set: common name=4-prenylphlorisovalerophenone}}
−
{{#set: completion rate=100.0}}
+
{{#set: molecular weight=277.339    }}
 +
{{#set: common name=PPIVP|compound-X}}
 +
{{#set: consumed by=RXN-7810}}
 +
{{#set: produced by=RXN-7811}}

Latest revision as of 19:03, 21 March 2018

Metabolite CPD-7109

  • smiles:
    • CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C
  • inchi key:
    • InChIKey=LWLGKGHHVBVDKB-UHFFFAOYSA-M
  • common name:
    • 4-prenylphlorisovalerophenone
  • molecular weight:
    • 277.339
  • Synonym(s):
    • PPIVP
    • compound-X

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-7109&oldid=24258"