Difference between revisions of "Arachidoyl-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN ASN] == * smiles: ** C(CC(C(=O)[O-])[N+])(N)=O * inchi key: ** InChIKey=DCXYFEDJOCDNAF-REOH...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Arachidoyl-ACPs Arachidoyl-ACPs] == * common name: ** an arachidoyl-[acp] * Synonym(s): == Rea...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Arachidoyl-ACPs Arachidoyl-ACPs] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an arachidoyl-[acp] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN1G-445]] |
| − | + | ||
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN1G-395]] |
| − | + | ||
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=an arachidoyl-[acp]}} | |
| − | + | {{#set: consumed by=RXN1G-445}} | |
| − | + | {{#set: produced by=RXN1G-395}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: consumed by= | + | |
| − | {{#set: produced by= | + | |
| − | + | ||
Latest revision as of 19:04, 21 March 2018
Contents
Metabolite Arachidoyl-ACPs
- common name:
- an arachidoyl-[acp]
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"an arachidoyl-[acp" cannot be used as a page name in this wiki.
