Difference between revisions of "PWY6666-2"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FAD FAD] == * smiles: ** CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY6666-2 PWY6666-2] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FAD FAD] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY6666-2 PWY6666-2] ==
* smiles:
+
* taxonomic range:
** CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
* inchi key:
+
** InChIKey=IMGVNJNCCGXBHD-UYBVJOGSSA-K
+
 
* common name:
 
* common name:
** FAD
+
** dopamine degradation
* molecular weight:
+
** 782.533   
+
 
* Synonym(s):
 
* Synonym(s):
** flavin adenine dinucleotide oxidized
 
** flavin adenine dinucleotide
 
** flavitan
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[MEPROPCOA-FAD-RXN]]
+
'''2''' reactions found over '''5''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN6666-4]]
* [[FADSYN-RXN]]
+
** 2 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-15_002920]]
* [[RXN-14264]]
+
*** [[Ec-15_002910]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
* [[RXN6666-9]]
 +
** 5 associated gene(s):
 +
*** [[Ec-06_007310]]
 +
*** [[Ec-00_005410]]
 +
*** [[Ec-06_007300]]
 +
*** [[Ec-06_007320]]
 +
*** [[Ec-26_003630]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN6666-5 RXN6666-5]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN6666-6 RXN6666-6]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN6666-7 RXN6666-7]
 
== External links  ==
 
== External links  ==
* CAS : 146-14-5
+
{{#set: taxonomic range=TAX-33208}}
* Wikipedia : Flavin_adenine_dinucleotide
+
{{#set: common name=dopamine degradation}}
* PUBCHEM:
+
{{#set: reaction found=2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46906035 46906035]
+
{{#set: total reaction=5}}
* HMDB : HMDB01248
+
{{#set: completion rate=40.0}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00016 C00016]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.13082029.html 13082029]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57692 57692]
+
* BIGG : 33521
+
{{#set: smiles=CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6))}}
+
{{#set: inchi key=InChIKey=IMGVNJNCCGXBHD-UYBVJOGSSA-K}}
+
{{#set: common name=FAD}}
+
{{#set: molecular weight=782.533    }}
+
{{#set: common name=flavin adenine dinucleotide oxidized|flavin adenine dinucleotide|flavitan}}
+
{{#set: consumed by=MEPROPCOA-FAD-RXN}}
+
{{#set: produced by=FADSYN-RXN}}
+
{{#set: reversible reaction associated=RXN-14264}}
+

Latest revision as of 20:04, 21 March 2018

Pathway PWY6666-2

  • taxonomic range:
  • common name:
    • dopamine degradation
  • Synonym(s):

Reaction(s) found

2 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links