Difference between revisions of "CPD1F-136"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-14_006630 == * left end position: ** 6122979 * transcription direction: ** NEGATIVE * right end position: ** 6135248 * centisome position: ** 93.3...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-136 CPD1F-136] == * smiles: ** C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23)...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-14_006630 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-136 CPD1F-136] ==
−
* left end position:
+
* smiles:
−
** 6122979
+
** C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23))C4)))
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=KMLXVEXJZSTMBV-YDIYEOSVSA-M
−
* right end position:
+
* common name:
−
** 6135248
+
** ent-7α-hydroxykaur-16-en-19-oate
−
* centisome position:
+
* molecular weight:
−
** 93.332    
+
** 317.447    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0063_0058
+
** ent-7-α-hydroxykaurenoate
−
** Esi0063_0058
+
** ent-7-α-hydroxykaurenoic acid
−
** HAL HISRS
+
** 7-hydroxy-kaurenoic acid
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[HISTIDINE-AMMONIA-LYASE-RXN]]
+
* [[RXN1F-160]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
* [[1.14.13.79-RXN]]
−
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
−
* [[HISDEG-PWY]]
+
−
* [[PWY-5028]]
+
−
* [[HISHP-PWY]]
+
−
* [[PWY-5030]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=6122979}}
+
* LIPID_MAPS : LMPR0104540005
−
{{#set: transcription direction=NEGATIVE}}
+
* PUBCHEM:
−
{{#set: right end position=6135248}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200352 25200352]
−
{{#set: centisome position=93.332   }}
+
* CHEBI:
−
{{#set: common name=Esi_0063_0058|Esi0063_0058|HAL HISRS}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57298 57298]
−
{{#set: reaction associated=HISTIDINE-AMMONIA-LYASE-RXN}}
+
* LIGAND-CPD:
−
{{#set: pathway associated=HISDEG-PWY|PWY-5028|HISHP-PWY|PWY-5030}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C11875 C11875]
 +
{{#set: smiles=C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23))C4)))}}
 +
{{#set: inchi key=InChIKey=KMLXVEXJZSTMBV-YDIYEOSVSA-M}}
 +
{{#set: common name=ent-7α-hydroxykaur-16-en-19-oate}}
 +
{{#set: molecular weight=317.447   }}
 +
{{#set: common name=ent-7-α-hydroxykaurenoate|ent-7-α-hydroxykaurenoic acid|7-hydroxy-kaurenoic acid}}
 +
{{#set: consumed by=RXN1F-160}}
 +
{{#set: produced by=1.14.13.79-RXN}}

Latest revision as of 20:04, 21 March 2018

Metabolite CPD1F-136

  • smiles:
    • C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23))C4)))
  • inchi key:
    • InChIKey=KMLXVEXJZSTMBV-YDIYEOSVSA-M
  • common name:
    • ent-7α-hydroxykaur-16-en-19-oate
  • molecular weight:
    • 317.447
  • Synonym(s):
    • ent-7-α-hydroxykaurenoate
    • ent-7-α-hydroxykaurenoic acid
    • 7-hydroxy-kaurenoic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23))C4)))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD1F-136&oldid=24290"