Difference between revisions of "PWY-5130"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2K-ADIPATE 2K-ADIPATE] == * smiles: ** C(CC(=O)C(=O)[O-])CC(=O)[O-] * inchi key: ** InChIKey=FG...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5130 PWY-5130] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5130 PWY-5130] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | * | + | |
* common name: | * common name: | ||
| − | ** 2- | + | ** 2-oxobutanoate degradation I |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** 2- | + | ** 2-oxobutyrate catabolism |
| − | + | ** 2-oxobutyrate degradation | |
| − | + | ||
| − | ** 2- | + | |
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''2''' reactions found over '''3''' reactions in the full pathway |
| − | + | * [[PROPIONMET-PWY]] | |
| − | + | ** 0 associated gene: | |
| − | * [[ | + | * [[RXN-7790]] |
| + | ** 1 associated gene(s): | ||
| + | *** [[Ec-06_009010]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=2-oxobutanoate degradation I}} | |
| − | + | {{#set: common name=2-oxobutyrate catabolism|2-oxobutyrate degradation}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=3}} | |
| − | + | {{#set: completion rate=67.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name=2- | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:04, 21 March 2018
Pathway PWY-5130
- taxonomic range:
- common name:
- 2-oxobutanoate degradation I
- Synonym(s):
- 2-oxobutyrate catabolism
- 2-oxobutyrate degradation
Reaction(s) found
2 reactions found over 3 reactions in the full pathway
- PROPIONMET-PWY
- 0 associated gene:
- RXN-7790
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
