Difference between revisions of "THREDEHYD-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FAD FAD] == * smiles: ** CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THREDEHYD-RXN THREDEHYD-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Tryptophan synthase...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FAD FAD] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=THREDEHYD-RXN THREDEHYD-RXN] ==
* smiles:
+
* direction:
** CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=IMGVNJNCCGXBHD-UYBVJOGSSA-K
+
 
* common name:
 
* common name:
** FAD
+
** Tryptophan synthase beta subunit-like PLP-dependent enzyme
* molecular weight:
+
** L-threonine ammonia-lyase
** 782.533   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/4.3.1.19 EC-4.3.1.19]
 
* Synonym(s):
 
* Synonym(s):
** flavin adenine dinucleotide oxidized
 
** flavin adenine dinucleotide
 
** flavitan
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[MEPROPCOA-FAD-RXN]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[THR]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[2-OXOBUTANOATE]][c]
* [[FADSYN-RXN]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 L-threonine[c] '''=>''' 1 ammonium[c] '''+''' 1 2-oxobutanoate[c]
* [[RXN-14264]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-03_001910]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-06_007490]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY66-428]], L-threonine degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-428 PWY66-428]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 146-14-5
+
* RHEA:
* Wikipedia : Flavin_adenine_dinucleotide
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22108 22108]
* PUBCHEM:
+
* LIGAND-RXN:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46906035 46906035]
+
** [http://www.genome.jp/dbget-bin/www_bget?R00996 R00996]
* HMDB : HMDB01248
+
* UNIPROT:
* LIGAND-CPD:
+
** [http://www.uniprot.org/uniprot/P25306 P25306]
** [http://www.genome.jp/dbget-bin/www_bget?C00016 C00016]
+
** [http://www.uniprot.org/uniprot/Q04513 Q04513]
* CHEMSPIDER:
+
** [http://www.uniprot.org/uniprot/P37946 P37946]
** [http://www.chemspider.com/Chemical-Structure.13082029.html 13082029]
+
** [http://www.uniprot.org/uniprot/Q9JZW1 Q9JZW1]
* CHEBI:
+
** [http://www.uniprot.org/uniprot/Q02145 Q02145]
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57692 57692]
+
** [http://www.uniprot.org/uniprot/P66897 P66897]
* BIGG : 33521
+
** [http://www.uniprot.org/uniprot/Q9WYJ1 Q9WYJ1]
{{#set: smiles=CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6))}}
+
** [http://www.uniprot.org/uniprot/Q9PP95 Q9PP95]
{{#set: inchi key=InChIKey=IMGVNJNCCGXBHD-UYBVJOGSSA-K}}
+
** [http://www.uniprot.org/uniprot/P25379 P25379]
{{#set: common name=FAD}}
+
** [http://www.uniprot.org/uniprot/P00927 P00927]
{{#set: molecular weight=782.533    }}
+
** [http://www.uniprot.org/uniprot/P20506 P20506]
{{#set: common name=flavin adenine dinucleotide oxidized|flavin adenine dinucleotide|flavitan}}
+
** [http://www.uniprot.org/uniprot/P0AGF6 P0AGF6]
{{#set: consumed by=MEPROPCOA-FAD-RXN}}
+
** [http://www.uniprot.org/uniprot/P04968 P04968]
{{#set: produced by=FADSYN-RXN}}
+
** [http://www.uniprot.org/uniprot/P20132 P20132]
{{#set: reversible reaction associated=RXN-14264}}
+
** [http://www.uniprot.org/uniprot/P09367 P09367]
 +
** [http://www.uniprot.org/uniprot/Q9RWU8 Q9RWU8]
 +
** [http://www.uniprot.org/uniprot/Q9JUX5 Q9JUX5]
 +
** [http://www.uniprot.org/uniprot/Q9ZD93 Q9ZD93]
 +
** [http://www.uniprot.org/uniprot/P31212 P31212]
 +
** [http://www.uniprot.org/uniprot/P36007 P36007]
 +
** [http://www.uniprot.org/uniprot/P73375 P73375]
 +
** [http://www.uniprot.org/uniprot/Q9T0D1 Q9T0D1]
 +
** [http://www.uniprot.org/uniprot/Q39469 Q39469]
 +
** [http://www.uniprot.org/uniprot/Q93968 Q93968]
 +
** [http://www.uniprot.org/uniprot/Q9XAA4 Q9XAA4]
 +
** [http://www.uniprot.org/uniprot/O94634 O94634]
 +
** [http://www.uniprot.org/uniprot/O59791 O59791]
 +
{{#set: direction=LEFT-TO-RIGHT}}
 +
{{#set: common name=Tryptophan synthase beta subunit-like PLP-dependent enzyme}}
 +
{{#set: common name=L-threonine ammonia-lyase}}
 +
{{#set: ec number=EC-4.3.1.19}}
 +
{{#set: gene associated=Ec-03_001910|Ec-06_007490}}
 +
{{#set: in pathway=PWY66-428}}
 +
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 20:04, 21 March 2018

Reaction THREDEHYD-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Tryptophan synthase beta subunit-like PLP-dependent enzyme
    • L-threonine ammonia-lyase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 L-threonine[c] => 1 ammonium[c] + 1 2-oxobutanoate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-428, L-threonine degradation V: PWY66-428
    • 2 reactions found over 2 reactions in the full pathway

Reconstruction information

External links