Difference between revisions of "THREDEHYD-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=8-AMINO-7-OXONONANOATE 8-AMINO-7-OXONONANOATE] == * smiles: ** CC(C(CCCCCC([O-])=O)=O)[N+] * in...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THREDEHYD-RXN THREDEHYD-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Tryptophan synthase...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THREDEHYD-RXN THREDEHYD-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Tryptophan synthase beta subunit-like PLP-dependent enzyme |
− | * | + | ** L-threonine ammonia-lyase |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/4.3.1.19 EC-4.3.1.19] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[THR]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[2-OXOBUTANOATE]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 L-threonine[c] '''=>''' 1 ammonium[c] '''+''' 1 2-oxobutanoate[c] |
− | * [[ | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-03_001910]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-06_007490]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways == | ||
+ | * [[PWY66-428]], L-threonine degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-428 PWY66-428] | ||
+ | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * RHEA: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22108 22108] |
− | * | + | * LIGAND-RXN: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00996 R00996] |
− | * | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P25306 P25306] |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/Q04513 Q04513] |
− | * | + | ** [http://www.uniprot.org/uniprot/P37946 P37946] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9JZW1 Q9JZW1] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q02145 Q02145] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/P66897 P66897] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9WYJ1 Q9WYJ1] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9PP95 Q9PP95] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P25379 P25379] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P00927 P00927] |
+ | ** [http://www.uniprot.org/uniprot/P20506 P20506] | ||
+ | ** [http://www.uniprot.org/uniprot/P0AGF6 P0AGF6] | ||
+ | ** [http://www.uniprot.org/uniprot/P04968 P04968] | ||
+ | ** [http://www.uniprot.org/uniprot/P20132 P20132] | ||
+ | ** [http://www.uniprot.org/uniprot/P09367 P09367] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9RWU8 Q9RWU8] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9JUX5 Q9JUX5] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9ZD93 Q9ZD93] | ||
+ | ** [http://www.uniprot.org/uniprot/P31212 P31212] | ||
+ | ** [http://www.uniprot.org/uniprot/P36007 P36007] | ||
+ | ** [http://www.uniprot.org/uniprot/P73375 P73375] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9T0D1 Q9T0D1] | ||
+ | ** [http://www.uniprot.org/uniprot/Q39469 Q39469] | ||
+ | ** [http://www.uniprot.org/uniprot/Q93968 Q93968] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9XAA4 Q9XAA4] | ||
+ | ** [http://www.uniprot.org/uniprot/O94634 O94634] | ||
+ | ** [http://www.uniprot.org/uniprot/O59791 O59791] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=Tryptophan synthase beta subunit-like PLP-dependent enzyme}} | ||
+ | {{#set: common name=L-threonine ammonia-lyase}} | ||
+ | {{#set: ec number=EC-4.3.1.19}} | ||
+ | {{#set: gene associated=Ec-03_001910|Ec-06_007490}} | ||
+ | {{#set: in pathway=PWY66-428}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 20:04, 21 March 2018
Contents
Reaction THREDEHYD-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- Tryptophan synthase beta subunit-like PLP-dependent enzyme
- L-threonine ammonia-lyase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 THR[c] => 1 AMMONIUM[c] + 1 2-OXOBUTANOATE[c]
- With common name(s):
- 1 L-threonine[c] => 1 ammonium[c] + 1 2-oxobutanoate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-03_001910
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-06_007490
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
Pathways
- PWY66-428, L-threonine degradation V: PWY66-428
- 2 reactions found over 2 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: