Difference between revisions of "TRNA-2-thiouridine34"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEPHOSPHO-COA DEPHOSPHO-COA] == * smiles: ** CC(C)(COP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-2-thiouridine34 tRNA-2-thiouridine34] == * common name: ** a 2-thiouridine34 in tRNA * Syn...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEPHOSPHO-COA DEPHOSPHO-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-2-thiouridine34 tRNA-2-thiouridine34] ==
−
* smiles:
+
−
** CC(C)(COP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23))))C(O)C(=O)NCCC(=O)NCCS
+
−
* inchi key:
+
−
** InChIKey=KDTSHFARGAKYJN-IBOSZNHHSA-L
+
 
* common name:
 
* common name:
−
** 3'-dephospho-CoA
+
** a 2-thiouridine34 in tRNA
−
* molecular weight:
+
−
** 685.538   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-dephospho-CoA
+
** a tRNA 2-thiouridine34
−
** dephosphocoenzyme A
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[DEPHOSPHOCOAKIN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[PANTEPADENYLYLTRAN-RXN]]
+
* [[RXN0-2023]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* CAS : 3633-59-8
+
{{#set: common name=a 2-thiouridine34 in tRNA}}
−
* BIGG : 36283
+
{{#set: common name=a tRNA 2-thiouridine34}}
−
* PUBCHEM:
+
{{#set: produced by=RXN0-2023}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266562 45266562]
+
−
* HMDB : HMDB01373
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00882 C00882]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57328 57328]
+
−
* METABOLIGHTS : MTBLC57328
+
−
{{#set: smiles=CC(C)(COP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23))))C(O)C(=O)NCCC(=O)NCCS}}
+
−
{{#set: inchi key=InChIKey=KDTSHFARGAKYJN-IBOSZNHHSA-L}}
+
−
{{#set: common name=3'-dephospho-CoA}}
+
−
{{#set: molecular weight=685.538    }}
+
−
{{#set: common name=3-dephospho-CoA|dephosphocoenzyme A}}
+
−
{{#set: consumed by=DEPHOSPHOCOAKIN-RXN}}
+
−
{{#set: produced by=PANTEPADENYLYLTRAN-RXN}}
+

Latest revision as of 19:04, 21 March 2018

Metabolite tRNA-2-thiouridine34

  • common name:
    • a 2-thiouridine34 in tRNA
  • Synonym(s):
    • a tRNA 2-thiouridine34

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=TRNA-2-thiouridine34&oldid=24351"