Difference between revisions of "E-PHENYLITACONYL-COA"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4821 PWY-4821] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-82115 TAX-8...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=E-PHENYLITACONYL-COA E-PHENYLITACONYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C(CC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=E-PHENYLITACONYL-COA E-PHENYLITACONYL-COA] == |
− | * | + | * smiles: |
− | ** [ | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C(CC(=O)[O-])=CC1(C=CC=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-] |
− | ** | + | * inchi key: |
+ | ** InChIKey=CIZCKPNGZPENDV-UMUUVTGISA-I | ||
* common name: | * common name: | ||
− | ** | + | ** (E)-2-benzylidenesuccinyl-CoA |
+ | * molecular weight: | ||
+ | ** 950.677 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** E-phenylitaconyl-CoA |
− | + | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-902]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986140 50986140] |
− | + | * CHEBI: | |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27639 27639] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C09818 C09818] |
− | {{#set: | + | * HMDB : HMDB12223 |
− | {{#set: | + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C(CC(=O)[O-])=CC1(C=CC=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=CIZCKPNGZPENDV-UMUUVTGISA-I}} |
+ | {{#set: common name=(E)-2-benzylidenesuccinyl-CoA}} | ||
+ | {{#set: molecular weight=950.677 }} | ||
+ | {{#set: common name=E-phenylitaconyl-CoA}} | ||
+ | {{#set: consumed by=RXN-902}} |
Latest revision as of 19:04, 21 March 2018
Contents
Metabolite E-PHENYLITACONYL-COA
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C(CC(=O)[O-])=CC1(C=CC=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
- inchi key:
- InChIKey=CIZCKPNGZPENDV-UMUUVTGISA-I
- common name:
- (E)-2-benzylidenesuccinyl-CoA
- molecular weight:
- 950.677
- Synonym(s):
- E-phenylitaconyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C(CC(=O)[O-])=CC1(C=CC=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-" cannot be used as a page name in this wiki.