Difference between revisions of "PWY-7297"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEPHOSPHO-COA DEPHOSPHO-COA] == * smiles: ** CC(C)(COP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7297 PWY-7297] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33317 TAX-3...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEPHOSPHO-COA DEPHOSPHO-COA] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7297 PWY-7297] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)(COP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23))))C(O)C(=O)NCCC(=O)NCCS
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33317 TAX-33317]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7735 TAX-7735]
−
** InChIKey=KDTSHFARGAKYJN-IBOSZNHHSA-L
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-6157 TAX-6157]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7586 TAX-7586]
 
* common name:
 
* common name:
−
** 3'-dephospho-CoA
+
** octopamine biosynthesis
−
* molecular weight:
+
−
** 685.538   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-dephospho-CoA
 
−
** dephosphocoenzyme A
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[DEPHOSPHOCOAKIN-RXN]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[TYROSINE-DECARBOXYLASE-RXN]]
−
* [[PANTEPADENYLYLTRAN-RXN]]
+
** 1 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-14_004250]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14645 RXN-14645]
 
== External links  ==
 
== External links  ==
−
* CAS : 3633-59-8
+
{{#set: taxonomic range=TAX-33317}}
−
* BIGG : 36283
+
{{#set: taxonomic range=TAX-7735}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-6157}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266562 45266562]
+
{{#set: taxonomic range=TAX-7586}}
−
* HMDB : HMDB01373
+
{{#set: common name=octopamine biosynthesis}}
−
* LIGAND-CPD:
+
{{#set: reaction found=1}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00882 C00882]
+
{{#set: total reaction=2}}
−
* CHEBI:
+
{{#set: completion rate=50.0}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57328 57328]
+
−
* METABOLIGHTS : MTBLC57328
+
−
{{#set: smiles=CC(C)(COP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23))))C(O)C(=O)NCCC(=O)NCCS}}
+
−
{{#set: inchi key=InChIKey=KDTSHFARGAKYJN-IBOSZNHHSA-L}}
+
−
{{#set: common name=3'-dephospho-CoA}}
+
−
{{#set: molecular weight=685.538    }}
+
−
{{#set: common name=3-dephospho-CoA|dephosphocoenzyme A}}
+
−
{{#set: consumed by=DEPHOSPHOCOAKIN-RXN}}
+
−
{{#set: produced by=PANTEPADENYLYLTRAN-RXN}}
+

Latest revision as of 19:04, 21 March 2018

Pathway PWY-7297

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-7297&oldid=24364"