Difference between revisions of "PWY-5278"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12366 CPD-12366] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5278 PWY-5278] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12366 CPD-12366] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5278 PWY-5278] ==
* smiles:
+
* taxonomic range:
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=JCHLKIQZUXYLPW-UMMCILCDSA-J
+
 
* common name:
 
* common name:
** 8-oxo-GTP
+
** sulfite oxidation III
* molecular weight:
+
** 535.151   
+
 
* Synonym(s):
 
* Synonym(s):
** 8-oxo-guanosine-triphosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''2''' reactions in the full pathway
* [[RXN-11409]]
+
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[SULFATE-ADENYLYLTRANS-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-02_000870]]
 +
*** [[Ec-12_000240]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173271 46173271]
+
{{#set: common name=sulfite oxidation III}}
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))}}
+
{{#set: reaction found=2}}
{{#set: inchi key=InChIKey=JCHLKIQZUXYLPW-UMMCILCDSA-J}}
+
{{#set: total reaction=2}}
{{#set: common name=8-oxo-GTP}}
+
{{#set: completion rate=100.0}}
{{#set: molecular weight=535.151    }}
+
{{#set: common name=8-oxo-guanosine-triphosphate}}
+
{{#set: produced by=RXN-11409}}
+

Latest revision as of 20:04, 21 March 2018

Pathway PWY-5278

  • taxonomic range:
  • common name:
    • sulfite oxidation III
  • Synonym(s):

Reaction(s) found

2 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links