Difference between revisions of "Ec-04 003810"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8607 CPD-8607] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)...")
(Created page with "Category:Gene == Gene Ec-04_003810 == * left end position: ** 3866738 * transcription direction: ** NEGATIVE * right end position: ** 3895178 * centisome position: ** 59.3...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8607 CPD-8607] ==
+
== Gene Ec-04_003810 ==
−
* smiles:
+
* left end position:
−
** CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
+
** 3866738
−
* inchi key:
+
* transcription direction:
−
** InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol
+
** 3895178
−
* molecular weight:
+
* centisome position:
−
** 444.74    
+
** 59.380013    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0044_0148
 +
** Esi0044_0148
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN66-12]]
+
* Reaction: [[1-PHOSPHATIDYLINOSITOL-3-KINASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN66-11]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-6352]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3866738}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201302 25201302]
+
{{#set: transcription direction=NEGATIVE}}
−
* HMDB : HMDB12160
+
{{#set: right end position=3895178}}
−
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
+
{{#set: centisome position=59.380013    }}
−
{{#set: inchi key=InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N}}
+
{{#set: common name=Esi_0044_0148|Esi0044_0148}}
−
{{#set: common name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: reaction associated=1-PHOSPHATIDYLINOSITOL-3-KINASE-RXN}}
−
{{#set: molecular weight=444.74    }}
+
{{#set: pathway associated=PWY-6352}}
−
{{#set: consumed by=RXN66-12}}
+
−
{{#set: produced by=RXN66-11}}
+

Latest revision as of 19:05, 21 March 2018

Gene Ec-04_003810

  • left end position:
    • 3866738
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3895178
  • centisome position:
    • 59.380013
  • Synonym(s):
    • Esi_0044_0148
    • Esi0044_0148

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-04_003810&oldid=24401"