Difference between revisions of "RXN-9623"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBAMYUL-L-ASPARTATE CARBAMYUL-L-ASPARTATE] == * smiles: ** C(=O)([O-])CC(NC(N)=O)C([O-])=O *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9623 RXN-9623] == * direction: ** LEFT-TO-RIGHT * common name: ** long chain acyl-coA synthetas...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9623 RXN-9623] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** long chain acyl-coA synthetase |
− | * | + | ** long chain acyl-CoA synthetase |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/6.2.1.3 EC-6.2.1.3] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[PALMITATE]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[PALMITYL-COA]][c] '''+''' 1 [[AMP]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 palmitate[c] '''+''' 1 coenzyme A[c] '''+''' 1 ATP[c] '''=>''' 1 diphosphate[c] '''+''' 1 palmitoyl-CoA[c] '''+''' 1 AMP[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-12_008720]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-01_001560]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-02_006430]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-03_003710]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-5972]], stearate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5972 PWY-5972] | ||
+ | ** '''2''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971] | ||
+ | ** '''28''' reactions found over '''31''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30754 30754] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01280 R01280] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | * LIGAND- | + | {{#set: common name=long chain acyl-coA synthetase}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: common name=long chain acyl-CoA synthetase}} |
− | + | {{#set: ec number=EC-6.2.1.3}} | |
− | + | {{#set: gene associated=Ec-12_008720|Ec-01_001560|Ec-02_006430|Ec-03_003710}} | |
− | + | {{#set: in pathway=PWY-5972|PWY-5971}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} | |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:05, 21 March 2018
Contents
Reaction RXN-9623
- direction:
- LEFT-TO-RIGHT
- common name:
- long chain acyl-coA synthetase
- long chain acyl-CoA synthetase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 palmitate[c] + 1 coenzyme A[c] + 1 ATP[c] => 1 diphosphate[c] + 1 palmitoyl-CoA[c] + 1 AMP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-12_008720
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-01_001560
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
- Gene: Ec-02_006430
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
- Gene: Ec-03_003710
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
- PWY-5972, stearate biosynthesis I (animals and fungi): PWY-5972
- 2 reactions found over 6 reactions in the full pathway
- PWY-5971, palmitate biosynthesis II (bacteria and plants): PWY-5971
- 28 reactions found over 31 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links