Difference between revisions of "RXN-34"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8606 CPD-8606] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(C)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-34 RXN-34] == * direction: ** LEFT-TO-RIGHT * common name: ** Ureohydrolase * ec number: ** [ht...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8606 CPD-8606] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-34 RXN-34] ==
* smiles:
+
* direction:
** CC(C)CCCC([CH]4(C1(C)(C(C)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=MBZYKEVPFYHDOH-BQNIITSRSA-N
+
 
* common name:
 
* common name:
** 24,25-dihydrolanosterol
+
** Ureohydrolase
* molecular weight:
+
* ec number:
** 428.74   
+
** [http://enzyme.expasy.org/EC/3.5.3.1 EC-3.5.3.1]
 
* Synonym(s):
 
* Synonym(s):
** 4,4,14α-trimethyl-5α-cholesta-8-en-3β-ol
 
** 5alpha-lanost-8-en-3beta-ol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN66-11]]
+
* With identifiers:
* [[RXN-13707]]
+
** 1 [[CANAVANINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[UREA]][c] '''+''' 1 [[L-CANALINE]][c] '''+''' 1 [[PROTON]][c]
== Reaction(s) known to produce the compound ==
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 L-canavanine[c] '''+''' 1 H2O[c] '''=>''' 1 urea[c] '''+''' 1 L-canaline[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-10_001100]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-31]], canavanine degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-31 PWY-31]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6708537 6708537]
+
{{#set: common name=Ureohydrolase}}
* HMDB : HMDB06839
+
{{#set: ec number=EC-3.5.3.1}}
* LIGAND-CPD:
+
{{#set: gene associated=Ec-10_001100}}
** [http://www.genome.jp/dbget-bin/www_bget?C05109 C05109]
+
{{#set: in pathway=PWY-31}}
* CHEMSPIDER:
+
{{#set: reconstruction category=annotation}}
** [http://www.chemspider.com/Chemical-Structure.5140691.html 5140691]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28113 28113]
+
* METABOLIGHTS : MTBLC28113
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
+
{{#set: inchi key=InChIKey=MBZYKEVPFYHDOH-BQNIITSRSA-N}}
+
{{#set: common name=24,25-dihydrolanosterol}}
+
{{#set: molecular weight=428.74    }}
+
{{#set: common name=4,4,14α-trimethyl-5α-cholesta-8-en-3β-ol|5alpha-lanost-8-en-3beta-ol}}
+
{{#set: consumed by=RXN66-11|RXN-13707}}
+

Latest revision as of 19:05, 21 March 2018

Reaction RXN-34

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Ureohydrolase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 L-canavanine[c] + 1 H2O[c] => 1 urea[c] + 1 L-canaline[c] + 1 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-31, canavanine degradation: PWY-31
    • 1 reactions found over 2 reactions in the full pathway

Reconstruction information

External links