Difference between revisions of "Ec-01 002370"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7087 CPD-7087] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O) *...") |
(Created page with "Category:Gene == Gene Ec-01_002370 == * Synonym(s): ** Esi_0003_0068 ** Esi0003_0068 == Reactions associated == * Reaction: RXN-1404 ** Source: orthology-aragem =...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_002370 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0003_0068 |
+ | ** Esi0003_0068 | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[RXN-1404]] |
− | * [[ | + | ** Source: [[orthology-aragem]] |
− | == | + | == Pathways associated == |
− | * [[ | + | * [[PWY-581]] |
− | + | * [[PWY-5026]] | |
+ | * [[PWYQT-4476]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=Esi_0003_0068|Esi0003_0068}} | |
− | + | {{#set: reaction associated=RXN-1404}} | |
− | + | {{#set: pathway associated=PWY-581|PWY-5026|PWYQT-4476}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + |
Latest revision as of 19:05, 21 March 2018
Gene Ec-01_002370
- Synonym(s):
- Esi_0003_0068
- Esi0003_0068
Reactions associated
- Reaction: RXN-1404
- Source: orthology-aragem