Difference between revisions of "MALEAMATE"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-08_003020 == * left end position: ** 2878888 * transcription direction: ** NEGATIVE * right end position: ** 2885810 * centisome position: ** 42.9...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEAMATE MALEAMATE] == * smiles: ** C(=CC(=O)[O-])C(N)=O * inchi key: ** InChIKey=FSQQTNAZHBEJ...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEAMATE MALEAMATE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(=CC(=O)[O-])C(N)=O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=FSQQTNAZHBEJLS-UPHRSURJSA-M |
| − | * | + | * common name: |
| − | ** | + | ** maleamate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 114.08 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** maleic acid monoamide |
| − | ** | + | ** maleamic acid |
| + | ** (Z)-4-amino-4-oxo-but-2-enoate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-646]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 557-24-4 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460391 5460391] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: common name= | + | ** [http://www.chemspider.com/Chemical-Structure.4573932.html 4573932] |
| − | + | * CHEBI: | |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16146 16146] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01596 C01596] | ||
| + | {{#set: smiles=C(=CC(=O)[O-])C(N)=O}} | ||
| + | {{#set: inchi key=InChIKey=FSQQTNAZHBEJLS-UPHRSURJSA-M}} | ||
| + | {{#set: common name=maleamate}} | ||
| + | {{#set: molecular weight=114.08 }} | ||
| + | {{#set: common name=maleic acid monoamide|maleamic acid|(Z)-4-amino-4-oxo-but-2-enoate}} | ||
| + | {{#set: consumed by=RXN-646}} | ||
Latest revision as of 19:06, 21 March 2018
Contents
Metabolite MALEAMATE
- smiles:
- C(=CC(=O)[O-])C(N)=O
- inchi key:
- InChIKey=FSQQTNAZHBEJLS-UPHRSURJSA-M
- common name:
- maleamate
- molecular weight:
- 114.08
- Synonym(s):
- maleic acid monoamide
- maleamic acid
- (Z)-4-amino-4-oxo-but-2-enoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=CC(=O)[O-])C(N)=O" cannot be used as a page name in this wiki.
