Difference between revisions of "2-AMINOACRYLATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8678 CPD-8678] == * smiles: ** CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO * inchi key: ** InChIKey=R...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-AMINOACRYLATE 2-AMINOACRYLATE] == * smiles: ** C=C(N)C(=O)[O-] * inchi key: ** InChIKey=UQBOJ...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-AMINOACRYLATE 2-AMINOACRYLATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C=C(N)C(=O)[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=UQBOJOOOTLPNST-UHFFFAOYSA-M |
* common name: | * common name: | ||
| − | ** | + | ** 2-aminoprop-2-enoate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 86.07 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2-aminoacrylate |
| − | ** | + | ** α-aminoacrylate |
| + | ** 2-aminoacrylic acid | ||
| + | ** 2,3-didehydroalanine | ||
| + | ** α,β-dehydroalanine | ||
| + | ** anhydroserine 2-aminopropenoic acid | ||
| + | ** dehydroalanine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-15124]] | ||
| + | * [[RXN-8899]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-15131]] |
| + | * [[RXN-15129]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-15137]] | ||
| + | * [[RXN-15128]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22022579 22022579] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.10759332.html 10759332] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58020 58020] |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02218 C02218] |
| − | {{#set: smiles= | + | * HMDB : HMDB03609 |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C=C(N)C(=O)[O-]}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=UQBOJOOOTLPNST-UHFFFAOYSA-M}} |
| − | {{#set: molecular weight= | + | {{#set: common name=2-aminoprop-2-enoate}} |
| − | {{#set: common name= | + | {{#set: molecular weight=86.07 }} |
| − | {{#set: produced by=RXN- | + | {{#set: common name=2-aminoacrylate|α-aminoacrylate|2-aminoacrylic acid|2,3-didehydroalanine|α,β-dehydroalanine|anhydroserine 2-aminopropenoic acid|dehydroalanine}} |
| + | {{#set: consumed by=RXN-15124|RXN-8899}} | ||
| + | {{#set: produced by=RXN-15131|RXN-15129}} | ||
| + | {{#set: reversible reaction associated=RXN-15137|RXN-15128}} | ||
Latest revision as of 19:06, 21 March 2018
Contents
Metabolite 2-AMINOACRYLATE
- smiles:
- C=C(N)C(=O)[O-]
- inchi key:
- InChIKey=UQBOJOOOTLPNST-UHFFFAOYSA-M
- common name:
- 2-aminoprop-2-enoate
- molecular weight:
- 86.07
- Synonym(s):
- 2-aminoacrylate
- α-aminoacrylate
- 2-aminoacrylic acid
- 2,3-didehydroalanine
- α,β-dehydroalanine
- anhydroserine 2-aminopropenoic acid
- dehydroalanine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C(N)C(=O)[O-" cannot be used as a page name in this wiki.
