Difference between revisions of "Ec-06 008160"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7087 CPD-7087] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O) *...") |
(Created page with "Category:Gene == Gene Ec-06_008160 == * left end position: ** 5824812 * transcription direction: ** NEGATIVE * right end position: ** 5831479 * centisome position: ** 66.5...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-06_008160 == |
− | * | + | * left end position: |
− | ** | + | ** 5824812 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 5831479 |
− | * | + | * centisome position: |
− | ** | + | ** 66.51030 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0028_0151 |
+ | ** Esi0028_0151 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[POLYNUCLEOTIDE-ADENYLYLTRANSFERASE-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: automated-name-match | |
− | * | + | == Pathways associated == |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=5824812}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=5831479}} | |
− | + | {{#set: centisome position=66.51030 }} | |
− | + | {{#set: common name=Esi_0028_0151|Esi0028_0151}} | |
− | + | {{#set: reaction associated=POLYNUCLEOTIDE-ADENYLYLTRANSFERASE-RXN}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:06, 21 March 2018
Gene Ec-06_008160
- left end position:
- 5824812
- transcription direction:
- NEGATIVE
- right end position:
- 5831479
- centisome position:
- 66.51030
- Synonym(s):
- Esi_0028_0151
- Esi0028_0151
Reactions associated
- Reaction: POLYNUCLEOTIDE-ADENYLYLTRANSFERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome