Difference between revisions of "CPD-19163"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CERAMIDASE-RXN CERAMIDASE-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Ceramidase * ec n...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19163 CPD-19163] == * smiles: ** CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=CERAMIDASE-RXN CERAMIDASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19163 CPD-19163] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=OPMPWWFMNYWBGF-PKYBCSRXSA-J
 
* common name:
 
* common name:
** Ceramidase
+
** (2E,11Z)-octadecenoyl-CoA
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/3.5.1.23 EC-3.5.1.23]
+
** 1025.937   
 
* Synonym(s):
 
* Synonym(s):
 +
** 18:2-Δ2,Δ11-CoA
 +
** 2-trans,11-cis-octadecenoyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-17785]]
** 1 [[WATER]][c] '''+''' 1 [[N-Acylsphingosine]][c] '''=>''' 1 [[SPHINGOSINE]][c] '''+''' 1 [[Fatty-Acids]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-17784]]
** 1 H2O[c] '''+''' 1 a (4E)-sphing-4-enine ceramide[c] '''=>''' 1 sphingosine[c] '''+''' 1 a fatty acid[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Ec-26_006010]]
+
** ESILICULOSUS_GENOME
+
***AUTOMATED-NAME-MATCH
+
== Pathways  ==
+
* [[PWY3DJ-11470]], sphingosine and sphingosine-1-phosphate metabolism: [http://metacyc.org/META/NEW-IMAGE?object=PWY3DJ-11470 PWY3DJ-11470]
+
** '''4''' reactions found over '''5''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
{{#set: smiles=CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20856 20856]
+
{{#set: inchi key=InChIKey=OPMPWWFMNYWBGF-PKYBCSRXSA-J}}
* LIGAND-RXN:
+
{{#set: common name=(2E,11Z)-octadecenoyl-CoA}}
** [http://www.genome.jp/dbget-bin/www_bget?R01493 R01493]
+
{{#set: molecular weight=1025.937    }}
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=18:2-Δ2,Δ11-CoA|2-trans,11-cis-octadecenoyl-CoA}}
{{#set: common name=Ceramidase}}
+
{{#set: consumed by=RXN-17785}}
{{#set: ec number=EC-3.5.1.23}}
+
{{#set: produced by=RXN-17784}}
{{#set: gene associated=Ec-26_006010}}
+
{{#set: in pathway=PWY3DJ-11470}}
+
{{#set: reconstruction category=annotation}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 19:06, 21 March 2018

Metabolite CPD-19163

  • smiles:
    • CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=OPMPWWFMNYWBGF-PKYBCSRXSA-J
  • common name:
    • (2E,11Z)-octadecenoyl-CoA
  • molecular weight:
    • 1025.937
  • Synonym(s):
    • 18:2-Δ2,Δ11-CoA
    • 2-trans,11-cis-octadecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.