Difference between revisions of "PWY-7618"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z8Z11Z14Z17Z-EICOSAPENTAENOATE 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE] == * smiles: ** CCC=CCC=CCC=CC...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7618 PWY-7618] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z8Z11Z14Z17Z-EICOSAPENTAENOATE 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7618 PWY-7618] ==
* smiles:
+
* taxonomic range:
** CCC=CCC=CCC=CCC=CCC=CCCCC(=O)[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
* inchi key:
+
** InChIKey=JAZBEHYOTPTENJ-JLNKQSITSA-M
+
 
* common name:
 
* common name:
** icosapentaenoate
+
** ricinoleate biosynthesis
* molecular weight:
+
** 301.448   
+
 
* Synonym(s):
 
* Synonym(s):
** (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate
 
** timnodonic acid
 
** (5Z,8Z,11Z,14Z,17Z)-eicosapentaenoate
 
** (5Z,8Z,11Z,14Z,17Z)-icosapentaenoic acid
 
** EPA
 
** (5Z,8Z,11Z,14Z,17Z)-icosapentaenoate
 
** eicosapentaenoate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-12978]]
+
'''2''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-16151]]
* [[RXN-16139]]
+
** 1 associated gene(s):
* [[RXN-13431]]
+
*** [[Ec-16_002160]]
== Reaction(s) of unknown directionality ==
+
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-9670]]
 +
** 1 associated gene(s):
 +
*** [[Ec-16_002160]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16148 RXN-16148]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33090}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245749 25245749]
+
{{#set: common name=ricinoleate biosynthesis}}
* CHEBI:
+
{{#set: reaction found=2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58562 58562]
+
{{#set: total reaction=3}}
* Wikipedia : Eicosapentaenoate
+
{{#set: completion rate=67.0}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C06428 C06428]
+
* HMDB : HMDB01999
+
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCC(=O)[O-]}}
+
{{#set: inchi key=InChIKey=JAZBEHYOTPTENJ-JLNKQSITSA-M}}
+
{{#set: common name=icosapentaenoate}}
+
{{#set: molecular weight=301.448    }}
+
{{#set: common name=(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate|timnodonic acid|(5Z,8Z,11Z,14Z,17Z)-eicosapentaenoate|(5Z,8Z,11Z,14Z,17Z)-icosapentaenoic acid|EPA|(5Z,8Z,11Z,14Z,17Z)-icosapentaenoate|eicosapentaenoate}}
+
{{#set: consumed by=RXN-12978}}
+
{{#set: produced by=RXN-16139|RXN-13431}}
+

Latest revision as of 19:06, 21 March 2018

Pathway PWY-7618

  • taxonomic range:
  • common name:
    • ricinoleate biosynthesis
  • Synonym(s):

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links