Difference between revisions of "3-SULFINYL-PYRUVATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINYL-PYRUVATE 3-SULFINYL-PYRUVATE] == * smiles: ** C(S([O-])=O)C(=O)C(=O)[O-] * inchi key...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINYL-PYRUVATE 3-SULFINYL-PYRUVATE] == |
− | * | + | * smiles: |
− | ** [ | + | ** C(S([O-])=O)C(=O)C(=O)[O-] |
+ | * inchi key: | ||
+ | ** InChIKey=JXYLQEMXCAAMOL-UHFFFAOYSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** 3-sulfinopyruvate |
+ | * molecular weight: | ||
+ | ** 150.106 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-sulphinyl-pyruvate | ||
+ | ** β-sulfinylpyruvate | ||
+ | ** 3-sulfinyl-pyruvate | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]] | |
− | == Reaction(s) | + | |
− | * [ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05527 C05527] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1665 1665] |
− | {{#set: | + | * METABOLIGHTS : MTBLC1665 |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244536 25244536] | ||
+ | * HMDB : HMDB02332 | ||
+ | {{#set: smiles=C(S([O-])=O)C(=O)C(=O)[O-]}} | ||
+ | {{#set: inchi key=InChIKey=JXYLQEMXCAAMOL-UHFFFAOYSA-L}} | ||
+ | {{#set: common name=3-sulfinopyruvate}} | ||
+ | {{#set: molecular weight=150.106 }} | ||
+ | {{#set: common name=3-sulphinyl-pyruvate|β-sulfinylpyruvate|3-sulfinyl-pyruvate}} | ||
+ | {{#set: reversible reaction associated=3-SULFINOALANINE-AMINOTRANSFERASE-RXN}} |
Latest revision as of 20:06, 21 March 2018
Contents
Metabolite 3-SULFINYL-PYRUVATE
- smiles:
- C(S([O-])=O)C(=O)C(=O)[O-]
- inchi key:
- InChIKey=JXYLQEMXCAAMOL-UHFFFAOYSA-L
- common name:
- 3-sulfinopyruvate
- molecular weight:
- 150.106
- Synonym(s):
- 3-sulphinyl-pyruvate
- β-sulfinylpyruvate
- 3-sulfinyl-pyruvate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(S([O-])=O)C(=O)C(=O)[O-" cannot be used as a page name in this wiki.