Difference between revisions of "CPD1F-138"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-138 CPD1F-138] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7618 PWY-7618] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-138 CPD1F-138] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C=O)))
 +
* inchi key:
 +
** InChIKey=ZCTUNYRXJKLWPY-LLCOKINKSA-M
 
* common name:
 
* common name:
** ricinoleate biosynthesis
+
** gibberellin A12-aldehyde
 +
* molecular weight:
 +
** 315.431   
 
* Synonym(s):
 
* Synonym(s):
 +
** GA12-aldehyde
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''2''' reactions found over '''3''' reactions in the full pathway
+
* [[RXN1F-161]]
* [[RXN-16151]]
+
== Reaction(s) known to produce the compound ==
* [[RXN-9670]]
+
* [[RXN1F-160]]
== Reaction(s) not found ==
+
== Reaction(s) of unknown directionality ==
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16148 RXN-16148]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-33090}}
+
* PUBCHEM:
{{#set: common name=ricinoleate biosynthesis}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244417 25244417]
{{#set: reaction found=2}}
+
* CHEBI:
{{#set: reaction not found=3}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57432 57432]
{{#set: completion rate=67.0}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C06093 C06093]
 +
* HMDB : HMDB39484
 +
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C=O)))}}
 +
{{#set: inchi key=InChIKey=ZCTUNYRXJKLWPY-LLCOKINKSA-M}}
 +
{{#set: common name=gibberellin A12-aldehyde}}
 +
{{#set: molecular weight=315.431    }}
 +
{{#set: common name=GA12-aldehyde}}
 +
{{#set: consumed by=RXN1F-161}}
 +
{{#set: produced by=RXN1F-160}}

Latest revision as of 19:06, 21 March 2018

Metabolite CPD1F-138

  • smiles:
    • C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C=O)))
  • inchi key:
    • InChIKey=ZCTUNYRXJKLWPY-LLCOKINKSA-M
  • common name:
    • gibberellin A12-aldehyde
  • molecular weight:
    • 315.431
  • Synonym(s):
    • GA12-aldehyde

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C=O)))" cannot be used as a page name in this wiki.