Difference between revisions of "Ec-16 002340"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8058 CPD-8058] == * smiles: ** COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)) * inchi key...") |
(Created page with "Category:Gene == Gene Ec-16_002340 == * left end position: ** 2576801 * transcription direction: ** POSITIVE * right end position: ** 2582635 * centisome position: ** 48.2...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-16_002340 == |
− | * | + | * left end position: |
− | ** | + | ** 2576801 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2582635 |
− | * | + | * centisome position: |
− | ** | + | ** 48.27591 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0653_0001 |
− | ** | + | ** Esi0653_0001 |
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RXN-11135]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2576801}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | {{#set: | + | {{#set: right end position=2582635}} |
− | {{#set: | + | {{#set: centisome position=48.27591 }} |
− | {{#set: | + | {{#set: common name=Esi_0653_0001|Esi0653_0001}} |
− | {{#set: | + | {{#set: reaction associated=RXN-11135}} |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 20:06, 21 March 2018
Gene Ec-16_002340
- left end position:
- 2576801
- transcription direction:
- POSITIVE
- right end position:
- 2582635
- centisome position:
- 48.27591
- Synonym(s):
- Esi_0653_0001
- Esi0653_0001
Reactions associated
- Reaction: RXN-11135
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome