Difference between revisions of "Ec-16 002340"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8058 CPD-8058] == * smiles: ** COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)) * inchi key...")
 
(Created page with "Category:Gene == Gene Ec-16_002340 == * left end position: ** 2576801 * transcription direction: ** POSITIVE * right end position: ** 2582635 * centisome position: ** 48.2...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8058 CPD-8058] ==
+
== Gene Ec-16_002340 ==
−
* smiles:
+
* left end position:
−
** COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O))
+
** 2576801
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RSYNCMYDVZFZBP-NRORZAABSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** D-galactosylononitol
+
** 2582635
−
* molecular weight:
+
* centisome position:
−
** 356.326    
+
** 48.27591    
 
* Synonym(s):
 
* Synonym(s):
−
** galactosyl sequoyitol
+
** Esi_0653_0001
−
** O-α-D-galactopyranosyl-(1,3)-4O-methyl-D-myo-inositol
+
** Esi0653_0001
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-11135]]
−
* [[RXN-8281]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2576801}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202605 25202605]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O))}}
+
{{#set: right end position=2582635}}
−
{{#set: inchi key=InChIKey=RSYNCMYDVZFZBP-NRORZAABSA-N}}
+
{{#set: centisome position=48.27591   }}
−
{{#set: common name=D-galactosylononitol}}
+
{{#set: common name=Esi_0653_0001|Esi0653_0001}}
−
{{#set: molecular weight=356.326   }}
+
{{#set: reaction associated=RXN-11135}}
−
{{#set: common name=galactosyl sequoyitol|O-α-D-galactopyranosyl-(1,3)-4O-methyl-D-myo-inositol}}
+
−
{{#set: produced by=RXN-8281}}
+

Latest revision as of 19:06, 21 March 2018

Gene Ec-16_002340

  • left end position:
    • 2576801
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2582635
  • centisome position:
    • 48.27591
  • Synonym(s):
    • Esi_0653_0001
    • Esi0653_0001

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-16_002340&oldid=24582"