Difference between revisions of "Ec-24 000620"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-714 CPD-714] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1...")
 
(Created page with "Category:Gene == Gene Ec-24_000620 == * left end position: ** 723005 * transcription direction: ** POSITIVE * right end position: ** 729064 * centisome position: ** 14.495...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-714 CPD-714] ==
+
== Gene Ec-24_000620 ==
−
* smiles:
+
* left end position:
−
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** 723005
−
* inchi key:
+
* transcription direction:
−
** InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** cathasterone
+
** 729064
−
* molecular weight:
+
* centisome position:
−
** 432.685    
+
** 14.495841    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0019_0030
 +
** Esi0019_0030
 +
** UROD2
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-10642]]
−
* [[RXN-715]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[UROGENDECARBOX-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[HEMESYN2-PWY]]
 +
* [[PWY0-1415]]
 +
* [[PWY-7159]]
 +
* [[PWY-7766]]
 +
* [[CHLOROPHYLL-SYN]]
 +
* [[HEME-BIOSYNTHESIS-II]]
 +
* [[PWY-5531]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=723005}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203118 25203118]
+
{{#set: transcription direction=POSITIVE}}
−
* LIGAND-CPD:
+
{{#set: right end position=729064}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15790 C15790]
+
{{#set: centisome position=14.495841    }}
−
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: common name=Esi_0019_0030|Esi0019_0030|UROD2}}
−
{{#set: inchi key=InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N}}
+
{{#set: reaction associated=RXN-10642|UROGENDECARBOX-RXN}}
−
{{#set: common name=cathasterone}}
+
{{#set: pathway associated=HEMESYN2-PWY|PWY0-1415|PWY-7159|PWY-7766|CHLOROPHYLL-SYN|HEME-BIOSYNTHESIS-II|PWY-5531}}
−
{{#set: molecular weight=432.685    }}
+
−
{{#set: produced by=RXN-715}}
+

Latest revision as of 19:06, 21 March 2018

Gene Ec-24_000620

  • left end position:
    • 723005
  • transcription direction:
    • POSITIVE
  • right end position:
    • 729064
  • centisome position:
    • 14.495841
  • Synonym(s):
    • Esi_0019_0030
    • Esi0019_0030
    • UROD2

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-24_000620&oldid=24593"