Difference between revisions of "RXN-8342"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17638 CPD-17638] == * smiles: ** CCCCCC(O)CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8342 RXN-8342] == * direction: ** LEFT-TO-RIGHT * common name: ** molybdopterin synthase * ec n...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17638 CPD-17638] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8342 RXN-8342] ==
* smiles:
+
* direction:
** CCCCCC(O)CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=RXEDUSGPUQQZEW-XIRPNGCASA-J
+
 
* common name:
 
* common name:
** 7-hydroxylauroyl-CoA
+
** molybdopterin synthase
* molecular weight:
+
* ec number:
** 961.807   
+
** [http://enzyme.expasy.org/EC/2.8.1.12 EC-2.8.1.12]
 
* Synonym(s):
 
* Synonym(s):
** 7-hydroxydodecanoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-12184]]
+
** 1 [[PRECURSOR-Z]][c] '''+''' 2 [[Thiocarboxylated-MPT-synthases]][c] '''+''' 1 [[WATER]][c] '''=>''' 4 [[PROTON]][c] '''+''' 2 [[MPT-Synthases]][c] '''+''' 1 [[CPD-4]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 cyclic pyranopterin phosphate[c] '''+''' 2 a thiocarboxylated small subunit of molybdopterin synthase[c] '''+''' 1 H2O[c] '''=>''' 4 H+[c] '''+''' 2 a small subunit of molybdopterin synthase[c] '''+''' 1 molybdopterin[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-11_005720]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
* [[PWY-6823]], molybdenum cofactor biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6823 PWY-6823]
 +
** '''7''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819849 91819849]
+
{{#set: common name=molybdopterin synthase}}
{{#set: smiles=CCCCCC(O)CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: ec number=EC-2.8.1.12}}
{{#set: inchi key=InChIKey=RXEDUSGPUQQZEW-XIRPNGCASA-J}}
+
{{#set: gene associated=Ec-11_005720}}
{{#set: common name=7-hydroxylauroyl-CoA}}
+
{{#set: in pathway=PWY-6823}}
{{#set: molecular weight=961.807    }}
+
{{#set: reconstruction category=annotation}}
{{#set: common name=7-hydroxydodecanoyl-CoA}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
{{#set: produced by=RXN-12184}}
+
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 20:06, 21 March 2018

Reaction RXN-8342

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • molybdopterin synthase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6823, molybdenum cofactor biosynthesis: PWY-6823
    • 7 reactions found over 7 reactions in the full pathway

Reconstruction information

External links