Difference between revisions of "Ec-06 004450"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-SULFOQUINOVOSE UDP-SULFOQUINOVOSE] == * smiles: ** C(OP(=O)([O-])OP(=O)(OC1(OC(CS(=O)(=O)[O...")
(Created page with "Category:Gene == Gene Ec-06_004450 == * left end position: ** 3753574 * transcription direction: ** POSITIVE * right end position: ** 3763138 * centisome position: ** 42.8...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-SULFOQUINOVOSE UDP-SULFOQUINOVOSE] ==
+
== Gene Ec-06_004450 ==
−
* smiles:
+
* left end position:
−
** C(OP(=O)([O-])OP(=O)(OC1(OC(CS(=O)(=O)[O-])C(O)C(O)C(O)1))[O-])C2(C(O)C(O)C(O2)N3(C=CC(=O)NC(=O)3))
+
** 3753574
−
* inchi key:
+
* transcription direction:
−
** InChIKey=FQANCGQCBCUSMI-JZMIEXBBSA-K
+
** POSITIVE
−
* common name:
+
* right end position:
−
** UDP-α-D-sulfoquinovopyranose
+
** 3763138
−
* molecular weight:
+
* centisome position:
−
** 627.34    
+
** 42.859985    
 
* Synonym(s):
 
* Synonym(s):
−
** UDP-6-sulfoquinovose
+
** Esi_0062_0062
−
** UDP-sulfoquinovose
+
** Esi0062_0062
−
** UDP-α-D-sulfoquinovose
+
** Amt1;5
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-1224]]
+
* Reaction: [[RXN-9615]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-1223]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3753574}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200933 25200933]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=3763138}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60009 60009]
+
{{#set: centisome position=42.859985   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0062_0062|Esi0062_0062|Amt1;5}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11521 C11521]
+
{{#set: reaction associated=RXN-9615}}
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)(OC1(OC(CS(=O)(=O)[O-])C(O)C(O)C(O)1))[O-])C2(C(O)C(O)C(O2)N3(C=CC(=O)NC(=O)3))}}
+
−
{{#set: inchi key=InChIKey=FQANCGQCBCUSMI-JZMIEXBBSA-K}}
+
−
{{#set: common name=UDP-α-D-sulfoquinovopyranose}}
+
−
{{#set: molecular weight=627.34   }}
+
−
{{#set: common name=UDP-6-sulfoquinovose|UDP-sulfoquinovose|UDP-α-D-sulfoquinovose}}
+
−
{{#set: consumed by=RXN-1224}}
+
−
{{#set: produced by=RXN-1223}}
+

Latest revision as of 19:08, 21 March 2018

Gene Ec-06_004450

  • left end position:
    • 3753574
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3763138
  • centisome position:
    • 42.859985
  • Synonym(s):
    • Esi_0062_0062
    • Esi0062_0062
    • Amt1;5

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-06_004450&oldid=24763"