Difference between revisions of "CPD-8646"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5483 PWY-5483] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-554915 TAX-...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8646 CPD-8646] == * smiles: ** CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5483 PWY-5483] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8646 CPD-8646] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-554915 TAX-554915]
+
** CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
+
* inchi key:
 +
** InChIKey=RUSSPKPUXDSHNC-DDPQNLDTSA-N
 
* common name:
 
* common name:
** pyruvate fermentation to acetate III
+
** 7-dehydrodesmosterol
 +
* molecular weight:
 +
** 382.628   
 
* Synonym(s):
 
* Synonym(s):
 +
** 5α-cholesta-5,7,24-trien-3β-ol
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
* '''1''' reaction(s) found
+
* [[RXN66-27]]
** [[PYRUFLAVREDUCT-RXN]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) not found ==
+
* [[RXN-11887]]
* '''2''' reaction(s) not found
+
== Reaction(s) of unknown directionality ==
** [http://metacyc.org/META/NEW-IMAGE?object=ACETATE--COA-LIGASE-ADP-FORMING-RXN ACETATE--COA-LIGASE-ADP-FORMING-RXN]
+
** [http://metacyc.org/META/NEW-IMAGE?object=PWY-5535 PWY-5535]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-554915}}
+
* PUBCHEM:
{{#set: taxonomic range=TAX-2157}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986129 50986129]
{{#set: common name=pyruvate fermentation to acetate III}}
+
* CHEBI:
{{#set: reaction found=1}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27910 27910]
{{#set: reaction not found=2}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05107 C05107]
 +
* HMDB : HMDB03896
 +
{{#set: smiles=CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))}}
 +
{{#set: inchi key=InChIKey=RUSSPKPUXDSHNC-DDPQNLDTSA-N}}
 +
{{#set: common name=7-dehydrodesmosterol}}
 +
{{#set: molecular weight=382.628    }}
 +
{{#set: common name=5α-cholesta-5,7,24-trien-3β-ol}}
 +
{{#set: consumed by=RXN66-27}}
 +
{{#set: produced by=RXN-11887}}

Latest revision as of 20:08, 21 March 2018

Metabolite CPD-8646

  • smiles:
    • CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))
  • inchi key:
    • InChIKey=RUSSPKPUXDSHNC-DDPQNLDTSA-N
  • common name:
    • 7-dehydrodesmosterol
  • molecular weight:
    • 382.628
  • Synonym(s):
    • 5α-cholesta-5,7,24-trien-3β-ol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))" cannot be used as a page name in this wiki.