Difference between revisions of "CPD-1091"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-16_002070 == * left end position: ** 2271718 * transcription direction: ** NEGATIVE * right end position: ** 2274529 * centisome position: ** 42.5...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1091 CPD-1091] == * smiles: ** C(O)(C([O-])=O)NC(N)=O * inchi key: ** InChIKey=NWZYYCVIOKVT...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1091 CPD-1091] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)(C([O-])=O)NC(N)=O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=NWZYYCVIOKVTII-SFOWXEAESA-M |
| − | * | + | * common name: |
| − | ** | + | ** S-ureidoglycolate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 133.083 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (-)-ureidoglycolate |
| − | ** | + | ** ureidoglycolate |
| + | ** S-(-)-ureidoglycolate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[ALLANTOICASE-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 2017665 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615273 23615273] |
| − | {{#set: | + | * HMDB : HMDB01005 |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00603 C00603] | |
| − | {{#set: | + | * CHEMSPIDER: |
| + | ** [http://www.chemspider.com/Chemical-Structure.19951218.html 19951218] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57296 57296] | ||
| + | * BIGG : 1483307 | ||
| + | {{#set: smiles=C(O)(C([O-])=O)NC(N)=O}} | ||
| + | {{#set: inchi key=InChIKey=NWZYYCVIOKVTII-SFOWXEAESA-M}} | ||
| + | {{#set: common name=S-ureidoglycolate}} | ||
| + | {{#set: molecular weight=133.083 }} | ||
| + | {{#set: common name=(-)-ureidoglycolate|ureidoglycolate|S-(-)-ureidoglycolate}} | ||
| + | {{#set: produced by=ALLANTOICASE-RXN}} | ||
Latest revision as of 20:08, 21 March 2018
Contents
Metabolite CPD-1091
- smiles:
- C(O)(C([O-])=O)NC(N)=O
- inchi key:
- InChIKey=NWZYYCVIOKVTII-SFOWXEAESA-M
- common name:
- S-ureidoglycolate
- molecular weight:
- 133.083
- Synonym(s):
- (-)-ureidoglycolate
- ureidoglycolate
- S-(-)-ureidoglycolate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 2017665
- PUBCHEM:
- HMDB : HMDB01005
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : 1483307
"C(O)(C([O-])=O)NC(N)=O" cannot be used as a page name in this wiki.
