Difference between revisions of "RXN-7775"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTARYL-COA GLUTARYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCC(=O)[O-])=O)COP(=O)...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7775 RXN-7775] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTARYL-COA GLUTARYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7775 RXN-7775] ==
−
* smiles:
+
* direction:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=SYKWLIJQEHRDNH-CKRMAKSASA-I
+
** [http://enzyme.expasy.org/EC/1.14.11.9 EC-1.14.11.9]
−
* common name:
+
−
** glutaryl-CoA
+
−
* molecular weight:
+
−
** 876.595   
+
 
* Synonym(s):
 
* Synonym(s):
−
** glutaryl-coenzyme A
 
−
** 4-carboxybutanoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[2-KETO-ADIPATE-DEHYDROG-RXN]]
+
** 1 [[CPD-6994]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[SUC]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPD-474]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[RXN-8032]]
+
** 1 (2S)-eriodictyol[c] '''+''' 1 2-oxoglutarate[c] '''+''' 1 oxygen[c] '''=>''' 1 succinate[c] '''+''' 1 CO2[c] '''+''' 1 (+)-taxifolin[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-19_002760]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-08_003510]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-19_002750]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY1F-823]], leucopelargonidin and leucocyanidin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY1F-823 PWY1F-823]
 +
** '''3''' reactions found over '''4''' reactions in the full pathway
 +
* [[PWY-6787]], flavonoid biosynthesis (in equisetum): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6787 PWY-6787]
 +
** '''6''' reactions found over '''10''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
* LIGAND-RXN:
−
** [http://www.genome.jp/dbget-bin/www_bget?C00527 C00527]
+
** [http://www.genome.jp/dbget-bin/www_bget?R03640 R03640]
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57378 57378]
+
{{#set: ec number=EC-1.14.11.9}}
−
* METABOLIGHTS : MTBLC57378
+
{{#set: gene associated=Ec-19_002760|Ec-08_003510|Ec-19_002750}}
−
* PUBCHEM:
+
{{#set: in pathway=PWY1F-823|PWY-6787}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266604 45266604]
+
{{#set: reconstruction category=orthology}}
−
* HMDB : HMDB01339
+
{{#set: reconstruction source=orthology-aragem}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=SYKWLIJQEHRDNH-CKRMAKSASA-I}}
+
−
{{#set: common name=glutaryl-CoA}}
+
−
{{#set: molecular weight=876.595    }}
+
−
{{#set: common name=glutaryl-coenzyme A|4-carboxybutanoyl-CoA}}
+
−
{{#set: produced by=2-KETO-ADIPATE-DEHYDROG-RXN}}
+
−
{{#set: consumed or produced by=RXN-8032}}
+

Latest revision as of 19:09, 21 March 2018

Reaction RXN-7775

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY1F-823, leucopelargonidin and leucocyanidin biosynthesis: PWY1F-823
    • 3 reactions found over 4 reactions in the full pathway
  • PWY-6787, flavonoid biosynthesis (in equisetum): PWY-6787
    • 6 reactions found over 10 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-7775&oldid=24886"