Difference between revisions of "PWY-7307"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7649 CPD-7649] == * smiles: ** C1(=C(CC[N+])C=C(OS(=O)(=O)[O-])C(O)=C1) * inchi key: ** InC...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7307 PWY-7307] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7307 PWY-7307] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** oleate β-oxidation (reductase-dependent, yeast) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''1''' reactions found over '''3''' reactions in the full pathway | |
− | * [[ | + | * [[RXN-14715]] |
− | == Reaction(s) | + | ** 1 associated gene(s): |
+ | *** [[Ec-16_003950]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14714 RXN-14714] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14716 RXN-14716] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-4751}} | |
− | + | {{#set: common name=oleate β-oxidation (reductase-dependent, yeast)}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=3}} | |
− | + | {{#set: completion rate=33.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:09, 21 March 2018
Pathway PWY-7307
- taxonomic range:
- common name:
- oleate β-oxidation (reductase-dependent, yeast)
- Synonym(s):
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- RXN-14715
- 1 associated gene(s):
- 1 reconstruction source(s) associated: