Difference between revisions of "CPD-548"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-Asparagine Protein-L-Asparagine] == * common name: ** a [protein]-L-asparagine * Syno...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-548 CPD-548] == * smiles: ** C(C(NC(CCC([N+])C([O-])=O)=O)C(=O)NCC([O-])=O)SC=O * inchi key...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-548 CPD-548] == |
+ | * smiles: | ||
+ | ** C(C(NC(CCC([N+])C([O-])=O)=O)C(=O)NCC([O-])=O)SC=O | ||
+ | * inchi key: | ||
+ | ** InChIKey=FHXAGOICBFGEBF-BQBZGAKWSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** S-formylglutathione |
+ | * molecular weight: | ||
+ | ** 334.323 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[S-FORMYLGLUTATHIONE-HYDROLASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-2962]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[RXN0-276]] |
== External links == | == External links == | ||
− | {{#set: | + | * BIGG : 1485290 |
− | {{#set: consumed by= | + | * PUBCHEM: |
− | {{#set: reversible reaction associated= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246250 25246250] |
+ | * HMDB : HMDB01550 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01031 C01031] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16225 16225] | ||
+ | * METABOLIGHTS : MTBLC57688 | ||
+ | {{#set: smiles=C(C(NC(CCC([N+])C([O-])=O)=O)C(=O)NCC([O-])=O)SC=O}} | ||
+ | {{#set: inchi key=InChIKey=FHXAGOICBFGEBF-BQBZGAKWSA-M}} | ||
+ | {{#set: common name=S-formylglutathione}} | ||
+ | {{#set: molecular weight=334.323 }} | ||
+ | {{#set: consumed by=S-FORMYLGLUTATHIONE-HYDROLASE-RXN}} | ||
+ | {{#set: produced by=RXN-2962}} | ||
+ | {{#set: reversible reaction associated=RXN0-276}} |
Latest revision as of 20:09, 21 March 2018
Contents
Metabolite CPD-548
- smiles:
- C(C(NC(CCC([N+])C([O-])=O)=O)C(=O)NCC([O-])=O)SC=O
- inchi key:
- InChIKey=FHXAGOICBFGEBF-BQBZGAKWSA-M
- common name:
- S-formylglutathione
- molecular weight:
- 334.323
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : 1485290
- PUBCHEM:
- HMDB : HMDB01550
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57688
"C(C(NC(CCC([N+])C([O-])=O)=O)C(=O)NCC([O-])=O)SC=O" cannot be used as a page name in this wiki.