Difference between revisions of "4-IMIDAZOLEACETATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-COA-CARBOXYLTRANSFER-RXN ACETYL-COA-CARBOXYLTRANSFER-RXN] == * direction: ** LEFT-TO-RIGHT *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-IMIDAZOLEACETATE 4-IMIDAZOLEACETATE] == * smiles: ** C1(NC=C(CC(=O)[O-])N=1) * inchi key: **...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-COA-CARBOXYLTRANSFER-RXN ACETYL-COA-CARBOXYLTRANSFER-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-IMIDAZOLEACETATE 4-IMIDAZOLEACETATE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(NC=C(CC(=O)[O-])N=1)
 +
* inchi key:
 +
** InChIKey=PRJKNHOMHKJCEJ-UHFFFAOYSA-M
 
* common name:
 
* common name:
−
** Acetyl-CoA carboxylase, partial
+
** 4-imidazoleacetate
−
** acetyl-CoA carboxylase
+
* molecular weight:
−
* ec number:
+
** 125.107   
−
** [http://enzyme.expasy.org/EC/6.4.1.2 EC-6.4.1.2]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** imidazole-4-acetate
 +
** imidazoleacetic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[ATP]][c] '''+''' 1 [[HCO3]][c] '''+''' 1 [[ACETYL-COA]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[MALONYL-COA]][c]
+
* [[RXN-10089]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 ATP[c] '''+''' 1 hydrogen carbonate[c] '''+''' 1 acetyl-CoA[c] '''=>''' 1 phosphate[c] '''+''' 1 ADP[c] '''+''' 1 H+[c] '''+''' 1 malonyl-CoA[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Ec-19_003040]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Ec-03_001890]]
+
−
** Source: [[orthology-aragem]]
+
−
** Source: [[orthology-aragem]]
+
−
* Gene: [[Ec-14_002460]]
+
−
** Source: [[orthology-aragem]]
+
−
** Source: [[orthology-aragem]]
+
−
* Gene: [[Ec-01_009720]]
+
−
** Source: [[orthology-aragem]]
+
−
** Source: [[orthology-aragem]]
+
−
* Gene: [[Ec-01_010970]]
+
−
** Source: [[orthology-aragem]]
+
−
** Source: [[orthology-aragem]]
+
−
* Gene: [[Ec-19_003230]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[orthology-aragem]]
+
−
** Source: [[orthology-aragem]]
+
−
* Gene: [[Ec-20_002520]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[orthology-aragem]]
+
−
** Source: [[orthology-aragem]]
+
−
== Pathways  ==
+
−
* [[PWY-7388]], octanoyl-[acyl-carrier protein] biosynthesis (mitochondria, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7388 PWY-7388]
+
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-5789]], 3-hydroxypropanoate/4-hydroxybutanate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5789 PWY-5789]
+
−
** '''6''' reactions found over '''16''' reactions in the full pathway
+
−
* [[PWY-5743]], 3-hydroxypropanoate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5743 PWY-5743]
+
−
** '''3''' reactions found over '''11''' reactions in the full pathway
+
−
* [[PWY-5744]], glyoxylate assimilation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5744 PWY-5744]
+
−
** '''2''' reactions found over '''11''' reactions in the full pathway
+
−
* [[PWY-6722]], candicidin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6722 PWY-6722]
+
−
** '''1''' reactions found over '''6''' reactions in the full pathway
+
−
* [[PWY-6679]], jadomycin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6679 PWY-6679]
+
−
** '''1''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-4381]], fatty acid biosynthesis initiation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4381 PWY-4381]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-aragem]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11308 11308]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4139109 4139109]
−
* LIGAND-RXN:
+
* HMDB : HMDB02024
−
** [http://www.genome.jp/dbget-bin/www_bget?R00742 R00742]
+
* LIGAND-CPD:
−
{{#set: direction=LEFT-TO-RIGHT}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C02835 C02835]
−
{{#set: common name=Acetyl-CoA carboxylase, partial}}
+
* CHEMSPIDER:
−
{{#set: common name=acetyl-CoA carboxylase}}
+
** [http://www.chemspider.com/Chemical-Structure.3351679.html 3351679]
−
{{#set: ec number=EC-6.4.1.2}}
+
* CHEBI:
−
{{#set: gene associated=Ec-19_003040|Ec-03_001890|Ec-14_002460|Ec-01_009720|Ec-01_010970|Ec-19_003230|Ec-20_002520}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57969 57969]
−
{{#set: in pathway=PWY-7388|PWY-5789|PWY-5743|PWY-5744|PWY-6722|PWY-6679|PWY-4381}}
+
* METABOLIGHTS : MTBLC57969
−
{{#set: reconstruction category=orthology|annotation}}
+
{{#set: smiles=C1(NC=C(CC(=O)[O-])N=1)}}
−
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
+
{{#set: inchi key=InChIKey=PRJKNHOMHKJCEJ-UHFFFAOYSA-M}}
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+
{{#set: common name=4-imidazoleacetate}}
 +
{{#set: molecular weight=125.107    }}
 +
{{#set: common name=imidazole-4-acetate|imidazoleacetic acid}}
 +
{{#set: produced by=RXN-10089}}

Latest revision as of 19:09, 21 March 2018

Metabolite 4-IMIDAZOLEACETATE

  • smiles:
    • C1(NC=C(CC(=O)[O-])N=1)
  • inchi key:
    • InChIKey=PRJKNHOMHKJCEJ-UHFFFAOYSA-M
  • common name:
    • 4-imidazoleacetate
  • molecular weight:
    • 125.107
  • Synonym(s):
    • imidazole-4-acetate
    • imidazoleacetic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(NC=C(CC(=O)[O-])N=1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=4-IMIDAZOLEACETATE&oldid=24908"