Difference between revisions of "PWY-5995"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CONIFERYL-ALDEHYDE CONIFERYL-ALDEHYDE] == * smiles: ** COC1(=CC(C=CC=O)=CC=C(O)1) * inchi key:...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5995 PWY-5995] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5995 PWY-5995] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** linoleate biosynthesis I (plants) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''2''' reactions found over '''4''' reactions in the full pathway | |
− | * [[RXN- | + | * [[RXN-16045]] |
− | == Reaction(s) | + | ** 1 associated gene(s): |
+ | *** [[Ec-16_002160]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-9670]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-16_002160]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16036 RXN-16036] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9669 RXN-9669] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: common name=linoleate biosynthesis I (plants)}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=4}} | |
− | + | {{#set: completion rate=50.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:09, 21 March 2018
Pathway PWY-5995
- taxonomic range:
- common name:
- linoleate biosynthesis I (plants)
- Synonym(s):
Reaction(s) found
2 reactions found over 4 reactions in the full pathway
- RXN-16045
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-9670
- 1 associated gene(s):
- 1 reconstruction source(s) associated: