Difference between revisions of "CPD-6701"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.3.99.5-RXN 1.3.99.5-RXN] == * direction: ** REVERSIBLE * common name: ** 3-oxo-5-alpha-steroid 4-...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] == * smiles: ** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1) * inchi key: **...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.3.99.5-RXN 1.3.99.5-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)
 +
* inchi key:
 +
** InChIKey=INAPMGSXUVUWAF-KXXVROSKSA-L
 
* common name:
 
* common name:
−
** 3-oxo-5-alpha-steroid 4-dehydrogenase
+
** 1D-myo-inositol 5-monophosphate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.3.1.22 EC-1.3.1.22]
+
** 258.121   
 
* Synonym(s):
 
* Synonym(s):
 +
** D-myo-inositol 5-monophosphate
 +
** Ins(5)P1
 +
** 1D-myo-inositol 5-phosphate
 +
** Ins(5)P
 +
** Ins5P
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-10953]]
−
** 1 [[3-Oxo-5-Alpha-Steroids]][c] '''+''' 1 [[NADP]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[3-Oxo-Delta-4-Steroids]][c] '''+''' 1 [[NADPH]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a 3-oxo-5-&alpha;-steroid[c] '''+''' 1 NADP+[c] '''<=>''' 1 H+[c] '''+''' 1 a 3-oxo-&Delta;4-steroid[c] '''+''' 1 NADPH[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-02_006180]]
+
−
** ESILICULOSUS_GENOME
+
−
***GO-TERM
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
{{#set: smiles=C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R02643 R02643]
+
{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-KXXVROSKSA-L}}
−
* UNIPROT:
+
{{#set: common name=1D-myo-inositol 5-monophosphate}}
−
** [http://www.uniprot.org/uniprot/P18405 P18405]
+
{{#set: molecular weight=258.121    }}
−
** [http://www.uniprot.org/uniprot/Q59327 Q59327]
+
{{#set: common name=D-myo-inositol 5-monophosphate|Ins(5)P1|1D-myo-inositol 5-phosphate|Ins(5)P|Ins5P}}
−
{{#set: direction=REVERSIBLE}}
+
{{#set: consumed by=RXN-10953}}
−
{{#set: common name=3-oxo-5-alpha-steroid 4-dehydrogenase}}
+
−
{{#set: ec number=EC-1.3.1.22}}
+
−
{{#set: gene associated=Ec-02_006180}}
+
−
{{#set: in pathway=}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Latest revision as of 19:09, 21 March 2018

Metabolite CPD-6701

  • smiles:
    • C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)
  • inchi key:
    • InChIKey=INAPMGSXUVUWAF-KXXVROSKSA-L
  • common name:
    • 1D-myo-inositol 5-monophosphate
  • molecular weight:
    • 258.121
  • Synonym(s):
    • D-myo-inositol 5-monophosphate
    • Ins(5)P1
    • 1D-myo-inositol 5-phosphate
    • Ins(5)P
    • Ins5P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-6701&oldid=24915"