Difference between revisions of "CPD-6701"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5122 PWY-5122] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] == * smiles: ** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1) * inchi key: **...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=INAPMGSXUVUWAF-KXXVROSKSA-L |
* common name: | * common name: | ||
| − | ** | + | ** 1D-myo-inositol 5-monophosphate |
| + | * molecular weight: | ||
| + | ** 258.121 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** D-myo-inositol 5-monophosphate |
| + | ** Ins(5)P1 | ||
| + | ** 1D-myo-inositol 5-phosphate | ||
| + | ** Ins(5)P | ||
| + | ** Ins5P | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-10953]] | |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
== External links == | == External links == | ||
| − | + | {{#set: smiles=C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)}} | |
| − | + | {{#set: inchi key=InChIKey=INAPMGSXUVUWAF-KXXVROSKSA-L}} | |
| − | {{#set: | + | {{#set: common name=1D-myo-inositol 5-monophosphate}} |
| − | {{#set: | + | {{#set: molecular weight=258.121 }} |
| − | {{#set: | + | {{#set: common name=D-myo-inositol 5-monophosphate|Ins(5)P1|1D-myo-inositol 5-phosphate|Ins(5)P|Ins5P}} |
| − | {{#set: | + | {{#set: consumed by=RXN-10953}} |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Latest revision as of 20:09, 21 March 2018
Contents
Metabolite CPD-6701
- smiles:
- C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)
- inchi key:
- InChIKey=INAPMGSXUVUWAF-KXXVROSKSA-L
- common name:
- 1D-myo-inositol 5-monophosphate
- molecular weight:
- 258.121
- Synonym(s):
- D-myo-inositol 5-monophosphate
- Ins(5)P1
- 1D-myo-inositol 5-phosphate
- Ins(5)P
- Ins5P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)" cannot be used as a page name in this wiki.
