Difference between revisions of "PWY-6863"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12935 CPD-12935] == * smiles: ** CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6863 PWY-6863] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12935 CPD-12935] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6863 PWY-6863] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCCC(C)=1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
** InChIKey=FTQSFEZUHZHOAT-BRZOAGJPSA-N
+
 
* common name:
 
* common name:
−
** 4'-apo-β-carotenal
+
** pyruvate fermentation to hexanol (engineered)
−
* molecular weight:
+
−
** 482.748   
+
 
* Synonym(s):
 
* Synonym(s):
−
** β-apo-4'-carotenal
 
−
** 4'-apo-β,ψ-caroten-4'-al
 
−
** 4'-apo-β,ψ-carotenal
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''7''' reactions found over '''11''' reactions in the full pathway
−
* [[RXN-11989]]
+
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[Ec-26_003940]]
 +
*** [[Ec-24_000870]]
 +
*** [[Ec-22_002850]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[PYRUFLAVREDUCT-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Ec-18_003420]]
 +
*** [[Ec-15_004230]]
 +
*** [[Ec-23_002710]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-11662]]
 +
** 2 associated gene(s):
 +
*** [[Ec-19_005290]]
 +
*** [[Ec-14_006530]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[RXN-11667]]
 +
** 2 associated gene(s):
 +
*** [[Ec-17_000320]]
 +
*** [[Ec-14_006530]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[RXN-12565]]
 +
** 2 associated gene(s):
 +
*** [[Ec-26_003940]]
 +
*** [[Ec-22_002850]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
* [[RXN-12567]]
 +
** 4 associated gene(s):
 +
*** [[Ec-16_001250]]
 +
*** [[Ec-14_006530]]
 +
*** [[Ec-06_001380]]
 +
*** [[Ec-16_003560]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-12570]]
 +
** 2 associated gene(s):
 +
*** [[Ec-14_006530]]
 +
*** [[Ec-19_005290]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=HEXANOL-RXN HEXANOL-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12558 RXN-12558]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12559 RXN-12559]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12568 RXN-12568]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2759}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C19892 C19892]
+
{{#set: taxonomic range=TAX-2}}
−
* CHEBI:
+
{{#set: common name=pyruvate fermentation to hexanol (engineered)}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=53157 53157]
+
{{#set: reaction found=7}}
−
* PUBCHEM:
+
{{#set: total reaction=11}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44224033 44224033]
+
{{#set: completion rate=64.0}}
−
{{#set: smiles=CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCCC(C)=1)}}
+
−
{{#set: inchi key=InChIKey=FTQSFEZUHZHOAT-BRZOAGJPSA-N}}
+
−
{{#set: common name=4'-apo-β-carotenal}}
+
−
{{#set: molecular weight=482.748    }}
+
−
{{#set: common name=β-apo-4'-carotenal|4'-apo-β,ψ-caroten-4'-al|4'-apo-β,ψ-carotenal}}
+
−
{{#set: produced by=RXN-11989}}
+

Latest revision as of 19:09, 21 March 2018

Pathway PWY-6863

  • taxonomic range:
  • common name:
    • pyruvate fermentation to hexanol (engineered)
  • Synonym(s):

Reaction(s) found

7 reactions found over 11 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-6863&oldid=24948"