Difference between revisions of "Ec-27 001950"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1083 CPD0-1083] == * smiles: ** C(C(C(C(C(C([O-])=O)O)O)O)O)O * inchi key: ** InChIKey=RGH...")
(Created page with "Category:Gene == Gene Ec-27_001950 == * left end position: ** 1652132 * transcription direction: ** POSITIVE * right end position: ** 1661607 * centisome position: ** 25.6...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1083 CPD0-1083] ==
+
== Gene Ec-27_001950 ==
−
* smiles:
+
* left end position:
−
** C(C(C(C(C(C([O-])=O)O)O)O)O)O
+
** 1652132
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RGHNJXZEOKUKBD-RSJOWCBRSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** aldehydo-L-galactonate
+
** 1661607
−
* molecular weight:
+
* centisome position:
−
** 195.149    
+
** 25.614819    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0036_0051
 +
** Esi0036_0051
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN0-2381]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-11152]]
+
*** Assignment: ec-number
 +
* Reaction: [[RXN0-2382]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[TRYPSYN-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[TRPSYN-PWY]]
 +
* [[PWY-6949]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1652132}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229140 44229140]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=1661607}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=53071 53071]
+
{{#set: centisome position=25.614819    }}
−
* BIGG : 3138483
+
{{#set: common name=Esi_0036_0051|Esi0036_0051}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=RXN0-2381|RXN0-2382|TRYPSYN-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?c15930 c15930]
+
{{#set: pathway associated=TRPSYN-PWY|PWY-6949}}
−
{{#set: smiles=C(C(C(C(C(C([O-])=O)O)O)O)O)O}}
+
−
{{#set: inchi key=InChIKey=RGHNJXZEOKUKBD-RSJOWCBRSA-M}}
+
−
{{#set: common name=aldehydo-L-galactonate}}
+
−
{{#set: molecular weight=195.149    }}
+
−
{{#set: reversible reaction associated=RXN-11152}}
+

Latest revision as of 19:09, 21 March 2018

Gene Ec-27_001950

  • left end position:
    • 1652132
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1661607
  • centisome position:
    • 25.614819
  • Synonym(s):
    • Esi_0036_0051
    • Esi0036_0051

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-27_001950&oldid=24967"