Difference between revisions of "Ec-17 002430"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP UDP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)) *...") |
(Created page with "Category:Gene == Gene Ec-17_002430 == * left end position: ** 2591539 * transcription direction: ** POSITIVE * right end position: ** 2598808 * centisome position: ** 54.0...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-17_002430 == |
− | * | + | * left end position: |
− | ** | + | ** 2591539 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2598808 |
− | * | + | * centisome position: |
− | ** | + | ** 54.013496 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0026_0091 |
− | ** | + | ** Esi0026_0091 |
+ | ** DOX | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[PEROXID-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * | + | *** Assignment: go-term |
− | * [[ | + | * Reaction: [[RXN-14240]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * | + | *** Assignment: go-term |
− | * | + | * Reaction: [[RXN-15288]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: go-term | |
− | * | + | * Reaction: [[RXN-17352]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * | + | *** Assignment: go-term |
− | * | + | * Reaction: [[RXN-8635]] |
− | * | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: go-term |
− | + | == Pathways associated == | |
− | * | + | * [[PWY-7214]] |
− | * [[ | + | * [[PWY-6824]] |
− | * | + | * [[PWY-7445]] |
− | * | + | * [[PWY-5469]] |
− | * | + | * [[PWY-5466]] |
− | * [[RXN- | + | * [[PWY-5461]] |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * | + | |
− | * | + | |
− | * [[RXN- | + | |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * | + | |
− | * | + | |
− | == | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2591539}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2598808}} | |
− | + | {{#set: centisome position=54.013496 }} | |
− | + | {{#set: common name=Esi_0026_0091|Esi0026_0091|DOX}} | |
− | + | {{#set: reaction associated=PEROXID-RXN|RXN-14240|RXN-15288|RXN-17352|RXN-8635}} | |
− | + | {{#set: pathway associated=PWY-7214|PWY-6824|PWY-7445|PWY-5469|PWY-5466|PWY-5461}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:10, 21 March 2018
Gene Ec-17_002430
- left end position:
- 2591539
- transcription direction:
- POSITIVE
- right end position:
- 2598808
- centisome position:
- 54.013496
- Synonym(s):
- Esi_0026_0091
- Esi0026_0091
- DOX
Reactions associated
- Reaction: PEROXID-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-14240
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-15288
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-17352
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-8635
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome